|
|
| | Flurbiprofen Impurity Basic information |
| Product Name: | Flurbiprofen Impurity | | Synonyms: | Flurbiprofen Impurity L;Flurbiprofen Ethyl Ester;[1,1'-Biphenyl]-4-acetic acid, 2-fluoro-α-methyl-, ethyl ester;ethyl2-(2-fluoro-4-biphenylyl)-propionate;Flurbiprofen axetil impurity1426;Flurbiprofen axetil impurity4;ethyl 2-(2-fluoro-[1,1'-biphenyl]-4-yl)propanoate? (Flurbiprofen Impurity）;ethyl 2-(2-fluoro-[1,1''-biphenyl]-4-yl)propanoate | | CAS: | 64858-90-8 | | MF: | C17H17FO2 | | MW: | 272.31 | | EINECS: | | | Product Categories: | | | Mol File: | 64858-90-8.mol |  |
| | Flurbiprofen Impurity Chemical Properties |
| Boiling point | 352.577±30.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.109±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C17H17FO2/c1-3-20-17(19)12(2)14-9-10-15(16(18)11-14)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3 | | InChIKey | JIYXQCWLSQSIJV-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(C1=CC=C(C2=CC=CC=C2)C(F)=C1)C |
| | Flurbiprofen Impurity Usage And Synthesis |
| | Flurbiprofen Impurity Preparation Products And Raw materials |
|