D-Desthiobiotin manufacturers
- D-Desthiobiotin
-
- $44.00
-
2026-05-06
- CAS:533-48-2
- Purity: 99.88%
- Supply Ability: 10g
- Dethiobiotin
-
-
2025-06-07
- CAS:533-48-2
- Min. Order: 5g
- Purity: >95.00%
- Supply Ability: 5g
|
| | D-Desthiobiotin Basic information |
| Product Name: | D-Desthiobiotin | | Synonyms: | 5-METHYL-2-OXO-4-IMIDAZOLINE-CAPROIC ACID;DL-DESTHIOBIOTIN;CAS_533-48-2;(4R-cis)-5-methyl-2-oxoimidazolidine-4-hexanoic acid;6-(5-methyl-2-oxo-imidazolidin-4-yl)hexanoic acid;5-Methyl-2-oxo-4-imidazolidinehexanoic acid;(4R)-2-Oxo-5α-methylimidazolidine-4α-hexanoic acid;[4R,5S,(+)]-5-Methyl-2-oxo-4-imidazolidinehexanoic acid | | CAS: | 533-48-2 | | MF: | C10H18N2O3 | | MW: | 214.26 | | EINECS: | 208-566-2 | | Product Categories: | | | Mol File: | 533-48-2.mol |  |
| | D-Desthiobiotin Chemical Properties |
| Melting point | 156-158° | | alpha | D21 +10.7° (c = 2) | | Boiling point | 354.4°C (rough estimate) | | density | 1.1404 (rough estimate) | | refractive index | 1.4550 (estimate) | | storage temp. | 2-8°C | | solubility | Aqueous Base (Slightly), DMSO (Slightly) | | form | Solid | | pka | 4.77±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C10H18N2O3/c1-7-8(12-10(15)11-7)5-3-2-4-6-9(13)14/h7-8H,2-6H2,1H3,(H,13,14)(H2,11,12,15)/t7-,8+/m0/s1 | | InChIKey | AUTOLBMXDDTRRT-UHFFFAOYSA-N | | SMILES | C1(=O)N[C@@H](C)[C@@H](CCCCCC(O)=O)N1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-Desthiobiotin Usage And Synthesis |
| Uses | D-Desthiobiotin is an analogue of Biotin (B389040) that binds less tightly to biotin-binding proteins such as Avidin and is easily displaced by Biotin. | | Definition | ChEBI: (4R,5S)-dethiobiotin is the (4R,5S)-isomer of dethiobiotin. It is a conjugate acid of a (4R,5S)-dethiobiotin(1-). It is an enantiomer of a (4S,5R)-dethiobiotin. | | Biological Activity | Desthiobiotin is a non-sulfur containing biotin derivative th at binds less strongly to biotin-binding proteins and is easily dislocated by biotin. | | IC 50 | Microbial Metabolite; Human Endogenous Metabolite | | Purification Methods | Dissolve desthiobiotin in 0.5% Na2CO3, filter, acidify with HCl to Congo Red, concentrate to a small volume (2-3 mL) to give fine needles, filter it off and recrystallise it twice from H2O, m 157-158o. It also crystallises from 95% EtOH. The methyl ester crystallises from MeOH and sublimes at 100o/high vacuum, m 69-70o, [] D +2.6o (c 2, CHCl3). [Melville et al. Science 98 497 1943, J Am Chem Soc 66 1422 1944, Beilstein 25 III/IV 1543.] |
| | D-Desthiobiotin Preparation Products And Raw materials |
|