| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- LXR-623
-
- $47.00
-
2026-07-13
- CAS:875787-07-8
- Purity: 99.24%
- Supply Ability: 10g
|
| | 2H-Indazole, 2-[(2-chloro-4-fluorophenyl)Methyl]-3-(4-fluorophenyl)-7-(trifluoroMethyl)- Basic information |
| | 2H-Indazole, 2-[(2-chloro-4-fluorophenyl)Methyl]-3-(4-fluorophenyl)-7-(trifluoroMethyl)- Chemical Properties |
| Melting point | 93℃ | | Boiling point | 528.4±50.0 °C(Predicted) | | density | 1.40 | | storage temp. | room temp | | solubility | DMSO:50.0(Max Conc. mg/mL);118.26(Max Conc. mM) Ethanol:52.0(Max Conc. mg/mL);123.0(Max Conc. mM) | | pka | -1.87±0.30(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C21H12ClF5N2/c22-18-10-15(24)9-6-13(18)11-29-20(12-4-7-14(23)8-5-12)16-2-1-3-17(19(16)28-29)21(25,26)27/h1-10H,11H2 | | InChIKey | KYWWJENKIMRJBI-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1c2n[n](c(c2ccc1)c4ccc(cc4)F)Cc3c(cc(cc3)F)Cl |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 2H-Indazole, 2-[(2-chloro-4-fluorophenyl)Methyl]-3-(4-fluorophenyl)-7-(trifluoroMethyl)- Usage And Synthesis |
| Uses | WAY 252623 is a novel and potent LXR (liverX receptor) β-agonist used as a potential candidate for the treatment of atopic dermatitis. | | Biochem/physiol Actions | WAY-252623 (LXR623) is an orally available, potent and highly selective Liver X receptors (LXRs) agonist that significantly reduced total and LDL-cholesterol. WAY-252623 reduces lesion progression in the murine LDLR(-/-) atherosclerosis model. | | in vivo | LXR-623 (400 mg/kg, p.o.) crosses the blood-brain barrier, induces target gene expression, and achieves therapeutic levels in GBM cells in the brain with minimal activity in the periphery. LXR-623 inhibits tumor growth, promotes tumor cell death, and prolongs the survival of mice bearing intracranial patient-derived GBMs[1]. LXR-623 (1.5, 5 mg/kg/day) significantly reduces progression of atherosclerosis in animals compared with the placebo group[2]. WAY-252623 (15 and 50 mg/kg) results in a significant reduction of atherosclerosis in a dose-dependent manner. WAY-252623 (20, 60, and 120 mg/kg/day, p.o.) displays neutral lipid effects in this CETP-expressing Syrian hamster[3]. Moreover, LXR-623 (50 mg/kg) induces gene expression in rodent peripheral blood cells in rat. LXR-623 (0, 15 and 50 mg/kg) dose-dependently upregulates transcription of ABCA1 and ABCG1 in monkey whole blood cells proportional to dose[4]. | | storage | Store at +4°C |
| | 2H-Indazole, 2-[(2-chloro-4-fluorophenyl)Methyl]-3-(4-fluorophenyl)-7-(trifluoroMethyl)- Preparation Products And Raw materials |
|