- Tenuifoliside A
-
- $56.00
-
2026-07-27
- CAS:139726-35-5
- Purity: 99.37%
- Supply Ability: 10g
|
| | Tenuifoliside A Basic information |
| Product Name: | Tenuifoliside A | | Synonyms: | Tenuifoliside A;α-D-Glucopyranoside, 3-O-[(2E)-1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propen-1-yl]-β-D-fructofuranosyl, 6-(4-hydroxybenzoate);(E)-(3,4,5-trihydroxy-6-((4-hydroxy-3-((3-(4-hydroxy-3,5-dimethoxyphenyl)acryloyl)oxy)-2,5-bis(hydroxymethyl)tetrahydrofuran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)methyl 4-hydroxybenzoate;Tenuifoliside A,cells,Extracellular signal regulated kinases,anti-apoptotic,Inhibitor,antidepressant-like,neneurotrophic,ERK,inhibit;((2R,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-(((2S,3S,4R,5R)-4-hydroxy-2,5-bis(hydroxymethyl)-3-(((E)-3-(3,4,5-trimethoxyphenyl)acryloyl)oxy)tetrahydrofuran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)methyl 4-hydroxybenzoate;Tenuifoliside Impurity 1;Tenuifoliside A, 10 mM in DMSO | | CAS: | 139726-35-5 | | MF: | C31H38O17 | | MW: | 682.63 | | EINECS: | | | Product Categories: | | | Mol File: | 139726-35-5.mol |  |
| | Tenuifoliside A Chemical Properties |
| Boiling point | 917.3±65.0 °C(Predicted) | | density | 1.55±0.1 g/cm3 (20 ºC 760 Torr) | | storage temp. | Store at -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 8.13±0.15(Predicted) | | color | White to off-white | | InChIKey | BBUQNXDJRVCZTI-UHFFFAOYSA-N | | SMILES | O(C1C(C(O)C(O)C(COC(C2C=CC(O)=CC=2)=O)O1)O)C1(OC(CO)C(O)C1OC(=O)C=CC1C=C(OC)C(OC)=C(OC)C=1)CO | | CAS DataBase Reference | 139726-35-5 |
| | Tenuifoliside A Usage And Synthesis |
| Uses | Tenuifoliside A is the active extract in Polygala. In recent years, more and more researches have been conducted on such chemical constituents in Polygalaceae, and its brain protection and anti-aging effects have been paid more and more attention. | | Biological Activity | Tenuifoliside A, isolated from Polygala, has anti-apoptotic and anti-depressant effects. In C6 cells, it exhibits its neurotrophic effects and promotes cell proliferation through the ERK/CREB/BDNF signaling pathway. |
| | Tenuifoliside A Preparation Products And Raw materials |
|