| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile Basic information |
| Product Name: | 1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile | | Synonyms: | 1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile(9CI);5-CYANO-7-AZAINDOLE;5-canyo-1H-Pyrrolo[2,3-b]pyridine;7-Azaindole-5-carbonitrile;7-Azaindole-5-carbonitrile,1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile;5-Cyano-1H-pyrrolo[2,3-b]pyridine;7-Azaindole-5-carbonitrile,97%;1H-PYRROLO[2,3-B]PYRIDINE-5-CARBONITRILE ISO 9001:2015 REACH | | CAS: | 517918-95-5 | | MF: | C8H5N3 | | MW: | 143.15 | | EINECS: | 1806241-263-5 | | Product Categories: | PYRIDINE;Boron, Nitrile, Thio,& TM-Cpds;Heterocycles;Heterocycle-Pyridine series | | Mol File: | 517918-95-5.mol | ![1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile Structure](CAS/GIF/517918-95-5.gif) |
| | 1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile Chemical Properties |
| Melting point | 225.1-225.2°C | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 12.50±0.40(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C8H5N3/c9-4-6-3-7-1-2-10-8(7)11-5-6/h1-3,5H,(H,10,11) | | InChIKey | DRAQIXNADYAISI-UHFFFAOYSA-N | | SMILES | C12NC=CC1=CC(C#N)=CN=2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile Usage And Synthesis |
| Chemical Properties | Yellow fine crystalline powder | | Uses | 5-Cyano-7-azaindole is a commonly used intermediate in the synthesis of new anti-tumor drug protease inhibitors, mainly used in laboratory research and development processes and chemical production processes. | | Synthesis | 1. 5-Bromo-1H-pyrrolo[2,3-b]pyridine (5.0 g, 25.0 mmol, 1.0 eq.) and zinc cyanide (3.6 g, 20.0 mmol, 0.8 eq.) were dissolved in anhydrous DMF (65 mL) and deoxygenated for 30 min under argon protection.
2. tetrakis(triphenylphosphine)palladium (1.7 g, 1.5 mmol, 0.06 eq.) was added and the reaction mixture was heated at 80 °C for 36 hours.
3. After completion of the reaction, the reaction was quenched with water and extracted with ethyl acetate (EtOAc).
4. The organic layers were combined, dried over anhydrous sodium sulfate (Na2SO4) and concentrated to dryness under reduced pressure.
5. The residue was treated with a small amount of dichloromethane (CH2Cl2) and the precipitate was collected by filtration.
6. The precipitate was washed with dichloromethane and dried over air to give 1H-pyrrolo[2,3-b]pyridine-5-carbonitrile (Intermediate 2a) as a white solid (3.0 g; yield: 83%; UPLC purity: 100%). | | References | [1] Patent: US2018/179199, 2018, A1. Location in patent: Paragraph 0451-0452 [2] Patent: WO2004/78756, 2004, A2. Location in patent: Page 120-121 [3] Patent: EP1782811, 2007, A1. Location in patent: Page/Page column 63 [4] Patent: WO2014/73904, 2014, A1. Location in patent: Paragraph 1425-1427 |
| | 1H-Pyrrolo[2,3-b]pyridine-5-carbonitrile Preparation Products And Raw materials |
|