- RGFP966 (E-isomer)
-
- $31.00 / 5mg
-
2026-01-12
- CAS:1396841-57-8
- Min. Order:
- Purity: 99.93%
- Supply Ability: 10g
|
| | RGFP966 Basic information |
| Product Name: | RGFP966 | | Synonyms: | 2-Propenamide, N-(2-amino-4-fluorophenyl)-3-[1-[(2E)-3-phenyl-2-propen-1-yl]-1H-pyrazol-4-yl]-, (2E)-;RGFP966 (E)-N-(2-Amino-4-fluorophenyl)-3-[1-[(E)-3-phenylprop-2-enyl]pyrazol-4-yl]prop-2-enamide;(E)-N-(2-amino-4-fluorophenyl)-3-(1-cinnamyl-1H-pyrazol-4-yl)acrylamide;2-Propenamide (N-(2-amino-4-fluorophenyl)-3-[1-[(2E)-3-phenyl-2-propen-1-yl]-1H-pyrazol-4-yl];RGFP966 Racemate;CS-1872;(E,E)-N-(2-Amino-4-fluorophenyl)-3-(1-cinnamyl-1H-pyrazol-4-yl)acrylamide;(E,E)-RGFP966 | | CAS: | 1396841-57-8 | | MF: | C21H19FN4O | | MW: | 362.4 | | EINECS: | | | Product Categories: | Inhibitors | | Mol File: | 1396841-57-8.mol |  |
| | RGFP966 Chemical Properties |
| Boiling point | 630.4±55.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 20mg/mL, clear | | form | powder | | pka | 11.58±0.70(Predicted) | | color | white to beige | | InChI | 1S/C21H19FN4O/c22-18-9-10-20(19(23)13-18)25-21(27)11-8-17-14-24-26(15-17)12-4-7-16-5-2-1-3-6-16/h1-11,13-15H,12,23H2,(H,25,27)/b7-4+,11-8+ | | InChIKey | BLVQHYHDYFTPDV-VCABWLAWSA-N | | SMILES | NC1=CC(F)=CC=C1NC(/C=C/C(C=N2)=CN2C/C=C/C3=CC=CC=C3)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | RGFP966 Usage And Synthesis |
| Uses | RGFP966 is a histone deacetylase 3 (HDAC3) inhibitor. | | Definition | ChEBI: N-(2-amino-4-fluorophenyl)-3-[1-(3-phenylprop-2-enyl)-4-pyrazolyl]-2-propenamide is an aromatic amide and an aromatic amine. | | Biochem/physiol Actions | RGFP966 changes signal-specific primary auditory cortical plasticity. It is highly effective in cardiomyopathy-associated pathologies. |
| | RGFP966 Preparation Products And Raw materials |
|