4-Azido-L-phenylalanine (hydrochloride) manufacturers
|
| | 4-Azido-L-phenylalanine (hydrochloride) Basic information |
| Product Name: | 4-Azido-L-phenylalanine (hydrochloride) | | Synonyms: | 4-Azido-L-phenylalanine (hydrochloride);p-Azidophenylalanine hydrochloride;p-Azido-L-phenylalanine hydrochloride;p-Azidophenylalanine,Inhibitor,4 Azido L phenylalanine hydrochloride,inhibit,4AzidoLphenylalanine hydrochloride;4-Azido-L-phenylalanine hydrochloride, 10 mM in DMSO;H-4-N3-Phe-OH;(S)-2-amino-3-(4-azidophenyl)propanoic acid hydrochloride;(2S)-2-amino-3-(4-azidophenyl)propanoic acid hydrochloride | | CAS: | 34670-43-4 | | MF: | C9H11ClN4O2 | | MW: | 242.66 | | EINECS: | | | Product Categories: | | | Mol File: | 34670-43-4.mol |  |
| | 4-Azido-L-phenylalanine (hydrochloride) Chemical Properties |
| Melting point | >176oC (dec.) | | storage temp. | Amber Vial, -20°C Freezer | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Off-White to Light Brown | | Stability: | Light Sensitive | | InChI | InChI=1/C9H10N4O2.ClH/c10-8(9(14)15)5-6-1-3-7(4-2-6)12-13-11;/h1-4,8H,5,10H2,(H,14,15);1H/t8-;/s3 | | InChIKey | VXCXRGSRHCHMBK-JNODIIHCNA-N | | SMILES | C(C1C=CC(N=[N+]=[N-])=CC=1)[C@H](N)C(=O)O.Cl |&1:10,r| |
| | 4-Azido-L-phenylalanine (hydrochloride) Usage And Synthesis |
| Uses | 4-Azido-L-phenylalanine is an unnatural derivative of L-phenylalanine (P319415), a nonpolar, essential amino acid that naturally occurs in the human body and is also used to treat patients with depression. |
| | 4-Azido-L-phenylalanine (hydrochloride) Preparation Products And Raw materials |
|