|
|
| | 3-(PERFLUOROHEXYL)PROPANOL Basic information |
| Product Name: | 3-(PERFLUOROHEXYL)PROPANOL | | Synonyms: | 3-(PERFLUOROHEXYL)PROPANOL;3-(PERFLUOROHEXYL)PROPANOL-1;4,4,5,5,6,6,7,7,8,8,9,9,9-TRIDECAFLUORO-1-NONANOL;1H,1H,2H,2H,3H,3H-PERFLUORONONAN-1-OL;3-(Perfluoro-n-hexyl)propanol;DAIKIN A-1630;3-(Perfluorohexyl) Propyl Alcohol;3-(perfluorohexyl)propanol,4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononan-1-ol | | CAS: | 80806-68-4 | | MF: | C9H7F13O | | MW: | 378.13 | | EINECS: | 670-981-3 | | Product Categories: | | | Mol File: | 80806-68-4.mol |  |
| | 3-(PERFLUOROHEXYL)PROPANOL Chemical Properties |
| Melting point | -3°C(lit.) | | Boiling point | 80 °C | | density | 1.629 | | refractive index | 1.329 | | Fp | 50℃ | | storage temp. | Refrigerator | | solubility | Benzene (Sparingly), Chloroform (Sparingly), DMSO (Slightly), Ethyl Acetate (Slightly) | | pka | 14.83±0.10(Predicted) | | form | Oil | | color | Colourless | | Specific Gravity | 1.629 | | InChI | InChI=1S/C9H7F13O/c10-4(11,2-1-3-23)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h23H,1-3H2 | | InChIKey | HMGDEQANNRNNKX-UHFFFAOYSA-N | | SMILES | C(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 80806-68-4(CAS DataBase Reference) | | EPA Substance Registry System | 3-(Perfluorohexyl)propanol (80806-68-4) |
| Hazard Codes | Xi | | RIDADR | UN 1987 3/PG III | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2905599890 |
| | 3-(PERFLUOROHEXYL)PROPANOL Usage And Synthesis |
| Uses | 1H,1H,2H,2H,3H,3H-Tridecafluoro-1-nonanol is used in preparation of fluoroalkyl vinyl ether by reaction of fluorinated alcohol with divinyl ether and/or trivinyl ether. |
| | 3-(PERFLUOROHEXYL)PROPANOL Preparation Products And Raw materials |
| Preparation Products | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl methacrylate |
|