Methylmercapto-D-galactopyranoside manufacturers
|
| | Methylmercapto-D-galactopyranoside Basic information |
| | Methylmercapto-D-galactopyranoside Chemical Properties |
| Melting point | 115-1170C | | Boiling point | 437.3±45.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | water: 50 mg/mL, clear, colorless | | pka | 12.92±0.70(Predicted) | | form | powder | | color | white | | biological source | synthetic | | Water Solubility | water: 50mg/mL, clear, colorless | | BRN | 81583 | | InChI | 1S/C7H14O5S/c1-13-7-6(11)5(10)4(9)3(2-8)12-7/h3-11H,2H2,1H3/t3-,4+,5+,6-,7+/m1/s1 | | InChIKey | LZFNFLTVAMOOPJ-PZRMXXKTSA-N | | SMILES | CS[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O | | CAS DataBase Reference | 155-30-6(CAS DataBase Reference) | | EPA Substance Registry System | .beta.-D-Galactopyranoside, methyl 1-thio- (155-30-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | - | | F | 10 | | TSCA | TSCA listed | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Methylmercapto-D-galactopyranoside Usage And Synthesis |
| Uses | Inhibition of β-glucosidase. | | Uses | Methyl-β-D-thiogalactoside has been used in a study to analyze inducers of the E.coli lac repressor system. It has also been used in a study that investigated the utilization of lactose by Streptococcus faecalis. | | Uses | Inhibition of glucosidase | | General Description | The uptake of methyl-β-D-thiogalactoside (TMG), lactose, and glucose is maintained by the phosphoenolpyruvate-dependent phosphotransferase system. |
| | Methylmercapto-D-galactopyranoside Preparation Products And Raw materials |
|