| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (Dimethylaminomethylene-aminomethylene)dimethylammonium chloride Basic information |
| Product Name: | (Dimethylaminomethylene-aminomethylene)dimethylammonium chloride | | Synonyms: | [3-(DIMETHYLAMINO)-2-AZAPROP-2-EN-1-YLIDENE]DIMETHYLAMMONIUM CHLORIDE;gold'S;[3-(Dimethylamino)-2-azaprop-2-en-1-ylidene]dimethylammonium chloride, (Dimethylaminomethyleneaminomethylene)dimethylammonium chloride;(([(Dimethylamino)methylidene]amino)methylidene)dimethylazanium chloride;Gold's Reagent 95%;Gold'sReagent>N-((((Dimethylamino)methylene)amino)methylene)-N-methylmethanaminium chloride;Gold′s Reagent, CAS 20353-93-9 | | CAS: | 20353-93-9 | | MF: | C6H14ClN3 | | MW: | 163.65 | | EINECS: | | | Product Categories: | | | Mol File: | 20353-93-9.mol |  |
| | (Dimethylaminomethylene-aminomethylene)dimethylammonium chloride Chemical Properties |
| Melting point | 100-102 °C (lit.) | | solubility | soluble in Methanol | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C6H14N3.ClH/c1-8(2)5-7-6-9(3)4;/h5-6H,1-4H3;1H/q+1;/p-1 | | InChIKey | DEIBXAPEZDJDRC-UHFFFAOYSA-M | | SMILES | N(C)(C)/C=N/C=[N+](/C)\C.[Cl-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2925.29.9000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (Dimethylaminomethylene-aminomethylene)dimethylammonium chloride Usage And Synthesis |
| Uses | Gold′s Reagent was used in the synthesis of 4-hydroxyquinazoline by reacting with ortho aminobenzoic acids. | | Uses |
[[[(Dimethylamino)methylene]amino]methylene]dimethylammonium Chloride is a β-dimethylaminomethylenating agent for ketones and amines; yields enamino derivatives of esters and lactones; converts Grignard reagents to aldehydes.
| | Synthesis | The Preparative Method of [[[(Dimethylamino)methylene]amino]methylene]dimethylammonium Chloride: a 1 L, one-necked, round-bottomed flask is equipped with a Claisen adapter, mechanical stirrer, reflux condenser, and mineral oil bubbler. The flask is charged with cyanuric chloride (73.8 g, 0.4 mol) (Caution: cyanuric chloride is a lachrymator and causes burns on contact with the skin), N,N-Dimethylformamide (175.4 g, 2.4 mol) and 1,4-dioxane (100 mL). The resulting solution is stirred and heated at 85 °C for 2-3 h while a considerable amount of carbon dioxide is evolved. When gas evolution is minimal, the reaction mixture is allowed to cool to room temperature; the product rapidly solidifies (eq 1). The flask which contains the solid product is connected to an isopropyl alcohol/dry ice trap and the solvent is removed by evacuating the system to approximately 0.05 mmHg. The crude product weighs 186-187 g (95% yield). Another method of isolating the product is by rapid filtration and washing with acetone. | | Precautions | Gold's reagent is very hygroscopic and should be handled under a moisture-free environment. If kept dry, it has a substantial shelf-life. Store in desiccator over anhydrous calcium sulfate.
|
| | (Dimethylaminomethylene-aminomethylene)dimethylammonium chloride Preparation Products And Raw materials |
|