| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R,S)-N-Nitrosoanatabine Basic information |
| Product Name: | (R,S)-N-Nitrosoanatabine | | Synonyms: | 3-[(1-Nitroso-1,2,3,6-tetrahydropyridin)-2-yl]pyridine;(S)-N-Nitroso Anatabine;(2S)-1,2,3,6-Tetrahydro-1-nitroso-2,3'-bipyridine;(S)-N-Nitrosoanatabine solution;3-[(2S)-1-nitroso-3,6-dihydro-2H-pyridin-2-yl]pyridine;2,3'-Bipyridine, 1,2,3,6-tetrahydro-1-nitroso-, (2S)-;(R,S) -N-nitroso neonicotinine (NAT);(S)-1-nitroso-1,2,3,6-tetrahydro-2,3'-bipyridine | | CAS: | 71267-22-6 | | MF: | C10H11N3O | | MW: | 189.21 | | EINECS: | 690-329-1 | | Product Categories: | Chiral Reagents;Heterocycles;Mutagenesis Research Chemicals;Nicotine Derivatives | | Mol File: | 71267-22-6.mol |  |
| | (R,S)-N-Nitrosoanatabine Chemical Properties |
| Boiling point | 324.47°C (rough estimate) | | density | 1.1654 (rough estimate) | | refractive index | 1.4830 (estimate) | | Fp | 2℃ | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 5.06±0.12(Predicted) | | form | Oil | | color | Pale Yellow to Brown | | Stability: | Light Sensitive | | Major Application | forensics and toxicology | | InChI | 1S/C10H11N3O/c14-12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h1-4,6,8,10H,5,7H2/t10-/m0/s1 | | InChIKey | ZJOFAFWTOKDIFH-JTQLQIEISA-N | | SMILES | N1([C@@H](CC=CC1)c2cnccc2)N=O | | CAS DataBase Reference | 71267-22-6(CAS DataBase Reference) | | IARC | 3 (Vol. 37, Sup 7, 89) 2007 |
| RIDADR | UN 1648 3 / PGII | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | (R,S)-N-Nitrosoanatabine Usage And Synthesis |
| Chemical Properties | Pale Yellow Oil | | Uses | The S-enantiomer metabolite of tobacco, a specific N-nitrosamines with carcinogenic activity. | | General Description | N-Nitrosoanatabine or NAT is a potent carcinogen and biomarker of exposure to cigarette smoke. It′s found in a variety of tobacco products such as cigarettes, electronic cigarettes, nicotine gum and oral snuff. This certified Snap-N-Spike solution is suitable for use in LC-MS/MS or GC/MS methods for nicotine testing, environmental monitoring, or clinical and diagnostic testing of nicotine biomarkers. | | Safety Profile | Questionable carcinogen. Whenheated to decomposition it emits toxic vapors of NOx. |
| | (R,S)-N-Nitrosoanatabine Preparation Products And Raw materials |
|