|
|
| | ISOBUTYLLITHIUM Basic information | | Uses |
| Product Name: | ISOBUTYLLITHIUM | | Synonyms: | isobutyllithiumsolution;LITHIUM 2-METHYL-1-PROPANIDE;ISOBUTYLLITHIUM;ISOBUTYLLITHIUM SOLUTION, ~15% IN HEPTANE;Isobutyllithium, 1.6M solution in heptane;Isobutyllithium1.6M solution in heptaneAcroSeal§3;Iso-Butyllithium 0.7M in hexanes;Isobutyllithium, 1.6M solution in heptane, AcroSeal | | CAS: | 920-36-5 | | MF: | C4H9Li | | MW: | 64.06 | | EINECS: | | | Product Categories: | | | Mol File: | 920-36-5.mol |  |
| | ISOBUTYLLITHIUM Chemical Properties |
| density | 0.69 g/mL at 20 °C | | Fp | -4℃ | | storage temp. | 2-8°C | | form | Liquid | | color | Yellow | | BRN | 4450775 | | InChI | InChI=1S/C4H9.Li/c1-4(2)3;/h4H,1H2,2-3H3; | | InChIKey | YZLMQRULZXAMEC-UHFFFAOYSA-N | | SMILES | C(C)(C)C[Li] | | CAS DataBase Reference | 920-36-5 |
| | ISOBUTYLLITHIUM Usage And Synthesis |
| Uses | Isobutyllithium is a useful reagent, catalyst, and precursor material that can be applied in thin film deposition, industrial chemistry, pharmaceuticals, LED manufacturing, and other fields. | | Chemical Properties | Yellowish solution |
| | ISOBUTYLLITHIUM Preparation Products And Raw materials |
|