|
|
| | 4,4',4'',4'''-methanetetrayltetrabenzoic acid Basic information |
| Product Name: | 4,4',4'',4'''-methanetetrayltetrabenzoic acid | | Synonyms: | 4,4',4'',4'''-methanetetrayltetrabenzoic acid;4-[tris(4-carboxyphenyl)methyl]benzoic acid;Benzoic acid, 4,4',4'',4'''-methanetetrayltetrakis-;4,4',4'',4'''-methanetetrayltetrabenzoic acid ISO 9001：2015 REACH;DK7636;4,4,4,4-methanetetrabenzoic acid;tetra(4-carboxyphenyl)methane;Tetrakis(4-carboxyphenyl)methane | | CAS: | 160248-28-2 | | MF: | C29H20O8 | | MW: | 496.46 | | EINECS: | | | Product Categories: | | | Mol File: | 160248-28-2.mol |  |
| | 4,4',4'',4'''-methanetetrayltetrabenzoic acid Chemical Properties |
| Boiling point | 758.9±60.0 °C(Predicted) | | density | 1.434±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.45±0.10(Predicted) | | Appearance | White to off-white Solid | | InChIKey | VSFXBCHNPQPWBX-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C=C1)C(O)=O)(C1=CC=C(C=C1)C(O)=O)(C1=CC=C(C=C1)C(O)=O)C1=CC=C(C=C1)C(O)=O |
| | 4,4',4'',4'''-methanetetrayltetrabenzoic acid Usage And Synthesis |
| Uses | 4,4',4'',4'''-Methanetetrayltetrabenzoic acid is used as a ligand in the synthesis of MOF materials, such as: MOF-812; MOF-841; MOF-36; SCU-11. |
| | 4,4',4'',4'''-methanetetrayltetrabenzoic acid Preparation Products And Raw materials |
|