|
|
| | tetrakis(4-carboxyphenyl)silane Basic information |
| Product Name: | tetrakis(4-carboxyphenyl)silane | | Synonyms: | tetrakis(4-carboxyphenyl)silane;Benzoic acid, 4,4',4'',4'''-silanetetrayltetrakis-;[4,4',4'',4'''-silanetetrayltetrabenzoic acid];DK7241;4,4',4'',4'''-Silanetetrayltetrabenzoic acid;4,4',4'',4'''-siliconalkanetrayltetrabenzenemacetic acid | | CAS: | 10256-84-5 | | MF: | C28H20O8Si | | MW: | 512.54 | | EINECS: | | | Product Categories: | | | Mol File: | 10256-84-5.mol |  |
| | tetrakis(4-carboxyphenyl)silane Chemical Properties |
| Melting point | >300 °C | | Boiling point | 727.3±60.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.31±0.10(Predicted) | | Appearance | White to off-white Solid | | InChIKey | SVQPJYAUEQAOEU-UHFFFAOYSA-N | | SMILES | [Si](C1=CC=C(C=C1)C(O)=O)(C1=CC=C(C=C1)C(O)=O)(C1=CC=C(C=C1)C(O)=O)C1=CC=C(C=C1)C(O)=O |
| | tetrakis(4-carboxyphenyl)silane Usage And Synthesis |
| | tetrakis(4-carboxyphenyl)silane Preparation Products And Raw materials |
|