|
|
| | Tetrakis(4-ethynylphenyl)ethene Basic information | | Uses |
| Product Name: | Tetrakis(4-ethynylphenyl)ethene | | Synonyms: | Tetrakis(4-ethynylphenyl)ethene;Tetrakis(4-ethynylphenyl)ethylene;1,1,2,2-tetrakis(4-ethynylphenyl)ethane;Tetrakis(4-ethynylphenyl)ethane;Benzene, 1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-ethynyl-;1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-ethynyl-benzene; Tetrakis(4-ethynylbenzene)ethylene;1,1,2,2-Tetrakis(4-ethynylphenyl)ethene - [T94015] | | CAS: | 4863-90-5 | | MF: | C34H20 | | MW: | 428.52 | | EINECS: | | | Product Categories: | | | Mol File: | 4863-90-5.mol |  |
| | Tetrakis(4-ethynylphenyl)ethene Chemical Properties |
| Melting point | 350 °C | | Boiling point | 537.6±50.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C34H20/c1-5-25-9-17-29(18-10-25)33(30-19-11-26(6-2)12-20-30)34(31-21-13-27(7-3)14-22-31)32-23-15-28(8-4)16-24-32/h1-4,9-24H | | InChIKey | LPAXHPNUGIPWEA-UHFFFAOYSA-N | | SMILES | C(/C1=CC=C(C#C)C=C1)(\C1=CC=C(C#C)C=C1)=C(\C1=CC=C(C#C)C=C1)/C1=CC=C(C#C)C=C1 |
| | Tetrakis(4-ethynylphenyl)ethene Usage And Synthesis |
| Uses | Tetra(4-ethynylphenyl)ethylene is used as an intermediate in the synthesis of materials. |
| | Tetrakis(4-ethynylphenyl)ethene Preparation Products And Raw materials |
|