2'-[(1,1-Dimethylethyl)phenylphosphino]-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine manufacturers
- (t-Bu)PhCPhos
-
- $2.00
-
2026-08-25
- CAS:1660153-91-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- (t-Bu)PhCPhos
-
-
2025-12-23
- CAS:1660153-91-2
- Min. Order: 100g
- Purity: 98%
- Supply Ability: 15KG
|
| | 2'-[(1,1-Dimethylethyl)phenylphosphino]-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine Basic information | | Reactions |
| Product Name: | 2'-[(1,1-Dimethylethyl)phenylphosphino]-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine | | Synonyms: | 2'-[(1,1-Dimethylethyl)phenylphosphino]-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine;2-(t-Butylphenylphosphino)-2',6'-dimethylamino-1,1'-biphenyl, 98% (t-Bu)PhCPhos;2-(t-Butylphenylphosphino)-2',6'-dimethylamino-1,1'-biphenyl, 98%;2-(t-Butylphenylphosphino)-2',6'-dimethylamino-1,1'-biphenyl, (t-Bu)PhCPhos;2-[(tert-Butyl)phenylphosphino]-2′,6′-bis(N,N-dimethylamino)biphenyl;2-(t-ButyL;98% (t-Bu)PhCPhos;phosphino)-2',6'-dimethyL | | CAS: | 1660153-91-2 | | MF: | C26H33N2P | | MW: | 404.53 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Buchwald Ligands Series;Buchwald Ligands&Precatalysts | | Mol File: | 1660153-91-2.mol | ![2'-[(1,1-Dimethylethyl)phenylphosphino]-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine Structure](CAS/20180629/GIF/1660153-91-2.gif) |
| | 2'-[(1,1-Dimethylethyl)phenylphosphino]-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine Chemical Properties |
| Melting point | 112 °C | | Boiling point | 537.6±50.0 °C(Predicted) | | pka | 5.00±0.28(Predicted) | | form | Powder | | color | white to off-white | | InChI | InChI=1S/C26H33N2P/c1-26(2,3)29(20-14-9-8-10-15-20)24-19-12-11-16-21(24)25-22(27(4)5)17-13-18-23(25)28(6)7/h8-19H,1-7H3 | | InChIKey | HTHOMNNVAUPLKK-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2P(C(C)(C)C)C2=CC=CC=C2)=C(N(C)C)C=CC=C1N(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 |
| | 2'-[(1,1-Dimethylethyl)phenylphosphino]-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine Usage And Synthesis |
| Reactions | Ligand for the Palladium-catalyzed Buchwald-Hartwig cross-coupling of hindered primary amines and aryl halides.
| | Uses | (t-Bu)PhCPhos is the Pd G3 complex, from the Buchwald group offers best-in-class performance in the arylation of sterically hindered primary amines. | | reaction suitability | reagent type: catalyst reaction type: Cross Couplings reagent type: ligand |
| | 2'-[(1,1-Dimethylethyl)phenylphosphino]-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine Preparation Products And Raw materials |
|