(Perfluorohexyl)acetic acid manufacturers
|
| | (Perfluorohexyl)acetic acid Basic information |
| Product Name: | (Perfluorohexyl)acetic acid | | Synonyms: | (Perfluorohexyl)acetic acid;2H,2H-Perfluorooctanoic acid;3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanoic acid;Octanoic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-;4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanoic acid;4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanoic acid in Methanol;2H,2H-Perfluorooctanoic acid 50 μg/mL in Methanol:Water;2H,2H-Perfluorooctanoic acid 50 μg/mL in Isopropanol | | CAS: | 53826-12-3 | | MF: | C8H3F13O2 | | MW: | 378.09 | | EINECS: | | | Product Categories: | | | Mol File: | 53826-12-3.mol |  |
| | (Perfluorohexyl)acetic acid Chemical Properties |
| Melting point | 55 °C(Solv: carbon tetrachloride (56-23-5)) | | Boiling point | 193.4±35.0 °C(Predicted) | | density | 1.670±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Acetone (Slightly), DMSO (Slightly) | | form | Solid | | pka | 3.38±0.10(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H3F13O2/c9-3(10,1-2(22)23)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1H2,(H,22,23) | | InChIKey | LRWIIEJPCFNNCZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | 6:2 FTCA (53826-12-3) |
| | (Perfluorohexyl)acetic acid Usage And Synthesis |
| Uses | (Perfluorohexyl)acetic Acid is a pollutant, present in solid waste from consumer products such as pizza boxes and teflon. | | Definition | ChEBI: 62FTA is a medium-chain fatty acid. |
| | (Perfluorohexyl)acetic acid Preparation Products And Raw materials |
|