|
|
| | 1H,1H,2H,2H-Perfluoro-1-octanol Basic information | | Synthesis |
| Product Name: | 1H,1H,2H,2H-Perfluoro-1-octanol | | Synonyms: | Capstone 62-AL;1H,1H,2H,2H-PERFLUOROOCTANOL;1,1,2,2-Tetrahydroperfluoro-1-octanol;3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-octano;3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-octan-1-ol;1H,1H,2H,2H-Tridecafluorooctan-1-ol 99%;1H,1H,2H,2H-Perfluorooctan-1-ol,min.97%;1-Octanol, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro- | | CAS: | 647-42-7 | | MF: | C8H5F13O | | MW: | 364.1 | | EINECS: | 211-477-1 | | Product Categories: | Organics;organofluorine compounds | | Mol File: | 647-42-7.mol |  |
| | 1H,1H,2H,2H-Perfluoro-1-octanol Chemical Properties |
| Boiling point | 88-95 °C28 mm Hg(lit.) | | density | 1.651 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.313(lit.) | | RTECS | RH1460000 | | Fp | 197 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Sparingly) | | form | liquid | | pka | 14.26±0.10(Predicted) | | Specific Gravity | 1.680 | | color | colorless | | Water Solubility | Miscible with chloroform and methanol. Immiscible with water. | | BRN | 1992757 | | Henry's Law Constant | 3.3×10-4 mol/(m3Pa) at 25℃, Abusallout et al. (2022) | | Cosmetics Ingredients Functions | DISPERSING NON-SURFACTANT
EMULSION STABILISING
PLASTICISER | | InChI | 1S/C8H5F13O/c9-3(10,1-2-22)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h22H,1-2H2 | | InChIKey | GRJRKPMIRMSBNK-UHFFFAOYSA-N | | SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 647-42-7(CAS DataBase Reference) | | EPA Substance Registry System | 1-Octanol, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro- (647-42-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 1 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29055900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1H,1H,2H,2H-Perfluoro-1-octanol Usage And Synthesis |
| Synthesis | 
Add 474g of perfluorohexylethyl iodine (C6F13CH2CH2I), 2370g of mixed solvent (1896g of NMP, 474g of DMSO), and 108g of water to a 5L glass reaction flask equipped with a condenser, magnetic stirrer, and thermometer. Stirring was started, and the temperature was raised to 160℃. The reaction was allowed to proceed for 18 hours. Gas chromatography analysis revealed the presence of 1.8% perfluorohexylethyl iodine. The reaction was then stopped, and distillation yielded 1H,1H,2H,2H-PERFLUORO-1-OCTANOL, specifically 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecylfluoro-1-octanol, with a conversion rate of 99.3%, a yield of 96.0%, and a gas chromatographic purity of 99.4%. | | Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 1H,1H,2H,2H-Perfluoro-1-octanol is a material used to improve nanotube composites. It is also used in the synthesis of a recyclable fluorous hydrazine carbothioate compound with NCS to catalyz e the acetalization of aldehydes. | | Uses | 1H,1H, 2H, 2H-Tridecafluoro-1-n-octanol is a material used to improve nanotube composites. It is also used in the synthesis of a recyclable fluorous hydrazine carbothioate compound with NCS to catalyze the acetalization of aldehydes. | | General Description | 1H,1H,2H,2H-Perfluoro-1-octanol is a fluorotelomer alcohol. |
| | 1H,1H,2H,2H-Perfluoro-1-octanol Preparation Products And Raw materials |
| Raw materials | 1H,1H,1H,2H-Perfluorooctan-2-ol-->Benzenepropanoic acid, 2-fluoro-β-hydroxy-, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl ester-->1,3-Propanediol, 1-(2-fluorophenyl)--->POTASSIUM METHACRYLATE-->(Perfluorohexyl)ethylene-->1H,1H,2H,2H-Perfluorooctyl iodide-->2-(Perfluorohexyl)ethyl methacrylate-->Catecholborane-->dimethylammonium iodide | | Preparation Products | 1-Phenyl-1,3-propanediol-->Diethyl (3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooct-1-yl)phosphonate-->(Perfluorohexyl)acetic acid-->Ethanol, 2-[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)oxy]- |
|