| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Methylindene-2-carboxylic acid Basic information |
| | 3-Methylindene-2-carboxylic acid Chemical Properties |
| Melting point | 201-203 °C(lit.) | | Boiling point | 306.9±21.0 °C(Predicted) | | density | 1.243±0.06 g/cm3(Predicted) | | pka | 4.44±0.20(Predicted) | | InChI | InChI=1S/C11H10O2/c1-7-9-5-3-2-4-8(9)6-10(7)11(12)13/h2-5H,6H2,1H3,(H,12,13) | | InChIKey | RONBYWGSEXDEKC-UHFFFAOYSA-N | | SMILES | C1C2=C(C=CC=C2)C(C)=C1C(O)=O |
| WGK Germany | 3 | | HS Code | 2916399090 |
| | 3-Methylindene-2-carboxylic acid Usage And Synthesis |
| | 3-Methylindene-2-carboxylic acid Preparation Products And Raw materials |
|