- H-Lys-Lys-OH.2hcl
-
- $1.00
-
2020-01-06
- CAS:52123-30-5
- Min. Order: 10g
- Purity: 98%
- Supply Ability: 100kg
|
| | H-Lys-Lys-OH 2HCl Basic information |
| Product Name: | H-Lys-Lys-OH 2HCl | | Synonyms: | LYS-LYS DIHYDROCHLORIDE CRYSTALLINE;L-LYSYL-L-LYSINE DIHYDROCHLORIDE;L-LYS-L-LYS 2 HCL;Lys(Lys).OME.HCL;Lys-lys2HClcrystalline;dilysine;L-Lysyl-L-lysine hydrochloride;Lysyllysine dihydrochloride | | CAS: | 52123-30-5 | | MF: | C12H27ClN4O3 | | MW: | 310.82 | | EINECS: | | | Product Categories: | | | Mol File: | 52123-30-5.mol |  |
| | H-Lys-Lys-OH 2HCl Chemical Properties |
| storage temp. | −20°C | | form | Crystalline Solid | | color | White to yellow | | Sensitive | Moisture Sensitive | | Major Application | peptide synthesis | | InChI | 1S/C12H26N4O3.ClH/c13-7-3-1-5-9(15)11(17)16-10(12(18)19)6-2-4-8-14;/h9-10H,1-8,13-15H2,(H,16,17)(H,18,19);1H | | InChIKey | ROGKVZGKYWMMAT-UHFFFAOYSA-N | | SMILES | Cl.NCCCCC(N)C(=O)NC(CCCCN)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | H-Lys-Lys-OH 2HCl Usage And Synthesis |
| Uses | Lysyllysine (Lys-Lys) may be used in studies of prebiotically relevant Salt-Induced Peptide Formation (SIPF) and in for physical chemical analysis. |
| | H-Lys-Lys-OH 2HCl Preparation Products And Raw materials |
|