| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-5-Norbornene-2,3-dicarbonyl chloride Basic information |
| Product Name: | trans-5-Norbornene-2,3-dicarbonyl chloride | | Synonyms: | trans-5-norbornene-3-dicarbonylchloride;trans-bicyclo(2.2.1)hept-5-enyl-2,3-dicarbonylchloride;(2-endo,3-exo)-bicyclo[2.2.1]hept-5-ene-2,3-dicarbonyl dichloride;trans-3,6-endo-Methylene-1,2,3,6-tetrahydrophthaloyl chloride,97%;TRANS-3,6-ENDO-METHYLENE-1,2,3,6-TETRAHYDROPHTHALOYL CHLORIDE;BICYCLO[2.2.1]-5-HEPTENE-2,3-DICARBONYL CHLORIDE;3,6-ENDOMETHYLENE-1,2,3,6-TETRAHYDROPHTHALOYL CHLORIDE;5-NORBORNENE-2,3-DICARBONYL CHLORIDE | | CAS: | 4582-21-2 | | MF: | C9H8Cl2O2 | | MW: | 219.06 | | EINECS: | 224-967-5 | | Product Categories: | | | Mol File: | 4582-21-2.mol |  |
| | trans-5-Norbornene-2,3-dicarbonyl chloride Chemical Properties |
| Boiling point | 114-118 °C/11 mmHg (lit.) | | density | 1.349 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.517(lit.) | | Fp | >230 °F | | InChI | 1S/C9H8Cl2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h1-2,4-7H,3H2/t4-,5+,6-,7-/m1/s1 | | InChIKey | KANQIAARVSWKKG-XZBKPIIZSA-N | | SMILES | ClC(=O)[C@@H]1[C@@H]2C[C@@H](C=C2)[C@H]1C(Cl)=O | | CAS DataBase Reference | 4582-21-2 |
| Hazard Codes | C | | Risk Statements | 20/21/22-34 | | Safety Statements | 23-26-28-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | RTECS | RB8225000 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29172000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal
Skin Corr. 1B | | Toxicity | LD50 orl-rat: 1830 mg/kg TXAPA9 28,313,74 |
| | trans-5-Norbornene-2,3-dicarbonyl chloride Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO YELLOWISH LIQUID | | Uses | Trans-3,6-endomethylene-1,2,3,6-tetrahydrophthaloyl chloride (tNBDC, trans-5-Norbornene-2,3-dicarbonyl chloride) undergoes interfacial polymerization reaction with 1,3-diaminopropane on the surface of a modified polyacrylonitrile (mPAN) during the fabrication of DAPE-SCC/mPAN or DAPE-tNBDC/mPAN TFC membranes. | | General Description | Trans-3,6-endomethylene-1,2,3,6-tetrahydrophthaloyl chloride (tNBDC, trans-5-Norbornene-2,3-dicarbonyl chloride) undergoes interfacial polymerization reaction with 1,3-diaminopropane on the surface of a modified polyacrylonitrile (mPAN) during the fabrication of DAPE-SCC/mPAN or DAPE-tNBDC/mPAN TFC membranes. | | Safety Profile | Moderately toxic by ingestion andskin contact. When heated to decomposition it emits toxicfumes of Clí. |
| | trans-5-Norbornene-2,3-dicarbonyl chloride Preparation Products And Raw materials |
|