|
|
| | 5-NORBORNENE-2-CARBONYL CHLORIDE Basic information |
| Product Name: | 5-NORBORNENE-2-CARBONYL CHLORIDE | | Synonyms: | BICYCLO[2.2.1]HEPT-5-ENE-2-CARBONYL CHLORIDE;5-NORBORNENE-2-CARBONYL CHLORIDE;5-NORBORNENE-2-CARBONYL CHLORIDE, 96-98%;Bicyclo[2.2.1]hept-5-ene-2-carboxylic acid chloride;Bicyclo[2.2.1]hepta-2-ene-5-carboxylic acid chloride;Bicyclo[2.2.1]hepta-5-ene-2-carbonyl chloride;Norborna-2-ene-5-carboxylic acid chloride;Norborna-5-ene-2-carboxylic acid chloride | | CAS: | 27063-48-5 | | MF: | C8H9ClO | | MW: | 156.61 | | EINECS: | 248-200-9 | | Product Categories: | Norbornene Derivatives;ACIDHALIDE | | Mol File: | 27063-48-5.mol |  |
| | 5-NORBORNENE-2-CARBONYL CHLORIDE Chemical Properties |
| Boiling point | 79-81 °C(Press: 12 Torr) | | density | 1.256±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C8H9ClO/c9-8(10)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2 | | InChIKey | HXYXVFUUHSZSNV-UHFFFAOYSA-N | | SMILES | C(Cl)(C1CC2CC1C=C2)=O | | CAS DataBase Reference | 27063-48-5(CAS DataBase Reference) |
| | 5-NORBORNENE-2-CARBONYL CHLORIDE Usage And Synthesis |
| | 5-NORBORNENE-2-CARBONYL CHLORIDE Preparation Products And Raw materials |
|