|
|
| | 4-(Bromomethyl)phenylboronic acid Basic information |
| | 4-(Bromomethyl)phenylboronic acid Chemical Properties |
| Melting point | 173-177 °C | | Boiling point | 343.1±44.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | pka | 8.51±0.17(Predicted) | | color | White | | BRN | 3030979 | | Stability: | Unstable in Aqueous Solution | | InChI | InChI=1S/C7H8BBrO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5H2 | | InChIKey | PDNOURKEZJZJNZ-UHFFFAOYSA-N | | SMILES | B(C1=CC=C(CBr)C=C1)(O)O | | CAS DataBase Reference | 68162-47-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36/37/38-20/21/22 | | Safety Statements | 26-36/37-36-36/37/39-22 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 4-(Bromomethyl)phenylboronic acid Usage And Synthesis |
| Chemical Properties | White solid | | Uses | Reactant involved in:
- Design of boronic acid-based autotaxin inhibitors
- Synthesis of boronated phosphonium salts
- Studies of incorporation of boronic acid groups to enhance gene transfection capability
- Investigations of the effect of boronic acid-positioning in optical glucose-sensing ensemble
| | Uses | Reactant involved in:• ;Design of boronic acid-based autotaxin inhibitors1• ;Synthesis of boronated phosphonium salts2• ;Studies of incorporation of boronic acid groups to enhance gene transfection capability2• ;Investigations of the effect of boronic acid-positioning in optical glucose-sensing ensemble3 | | Uses | suzuki reaction | | General Description | May contain varying amounts of anhydride |
| | 4-(Bromomethyl)phenylboronic acid Preparation Products And Raw materials |
|