| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- PKM2-IN-1
-
- $30.00
-
2026-09-10
- CAS:94164-88-2
- Purity: 99.90%
- Supply Ability: 10g
|
| | PKM2 inhibitor Basic information |
| Product Name: | PKM2 inhibitor | | Synonyms: | PKM2 inhibitor;PKM2-IN-1;PKM2-IN-1;COMPOUND 3K;piperidine-1-carbodithioic acid 3-methyl-1,4-dioxo-1,4-dihydronaphthalen-2-ylmethyl ester;PKM2 inhibitor 1;1-Piperidinecarbodithioic acid, (1,4-dihydro-3-methyl-1,4-dioxo-2-naphthalenyl)methyl ester;Pyruvate Kinase,inhibit,PKM2 IN 1,Inhibitor,PKM2IN1,PKM-2-IN-1;(3-Methyl-1,4-dioxo-1,4-dihydronaphthalen-2-yl)methyl piperidine-1-carbodithioate | | CAS: | 94164-88-2 | | MF: | C18H19NO2S2 | | MW: | 345.48 | | EINECS: | | | Product Categories: | | | Mol File: | 94164-88-2.mol |  |
| | PKM2 inhibitor Chemical Properties |
| Boiling point | 496.5±55.0 °C(Predicted) | | density | 1.302±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | DMF: 1 mg/ml; DMSO: insol; Ethanol: insol; PBS (pH 7.2): insol | | form | A solid | | pka | 0.81±0.20(Predicted) | | color | Light yellow to yellow | | InChI | 1S/C18H19NO2S2/c1-12-15(11-23-18(22)19-9-5-2-6-10-19)17(21)14-8-4-3-7-13(14)16(12)20/h3-4,7-8H,2,5-6,9-11H2,1H3 | | InChIKey | STAFOGVMELKGRI-UHFFFAOYSA-N | | SMILES | S(CC2=C(C(=O)c3c(cccc3)C2=O)C)C(=S)N1CCCCC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | PKM2 inhibitor Usage And Synthesis |
| Uses | PKM2-IN-1, is a pyruvate kinase M2 (PKM2) inhibitor with an IC50 of 2.95 μM. | | Biological Activity | Pyruvate kinase M2 (PKM2) inhibitor superior to shikonin.
Compound 3k (C3k) is a pyruvate kinase M2 (PKM2) inhibitor with 3-fold higher potency than shikonin (IC50 = 2.95 and 8.82 μM, respectively, by in vitro PKM2 LDH coupled assay). C3k exhibits potent cancer cell-selective antiproliferative activity in high PKM2-expressing cancer cultures (HCT116/HeLA/H1299 IC50 = 0.18/0.29/1.56 μM with C3k, 1.84/2.45/1.88 μM with shikonin) with much less cytotoxicity toward normal BEAS-2B human bronchial epithelial cells (IC50 = 18.46 μM; IC50 = 5.36 μM with shikonin). |
| | PKM2 inhibitor Preparation Products And Raw materials |
|