|
|
| | 3-HYDROXYHEPTANOIC ACID Basic information |
| Product Name: | 3-HYDROXYHEPTANOIC ACID | | Synonyms: | 3-HYDROXYHEPTANOIC ACID;3-Hydroxyheptanoic acid, 95 %;3-Hydroxyenanthic acid;rac-3-Hydroxyheptanoic Acid;Heptanoic acid, 3-hydroxy- | | CAS: | 17587-29-0 | | MF: | C7H14O3 | | MW: | 146.18 | | EINECS: | | | Product Categories: | | | Mol File: | 17587-29-0.mol |  |
| | 3-HYDROXYHEPTANOIC ACID Chemical Properties |
| Melting point | 40-41 °C | | Boiling point | 273.6±23.0 °C(Predicted) | | density | 1.070±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | pka | 4.38±0.10(Predicted) | | color | Off-White | | InChI | InChI=1S/C7H14O3/c1-2-3-4-6(8)5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10) | | InChIKey | OXSSIXNFGTZQMZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)CC(O)CCCC | | LogP | 0.764 (est) |
| | 3-HYDROXYHEPTANOIC ACID Usage And Synthesis |
| Uses | rac-3-Hydroxyheptanoic acid is used as a reagent to synthesize β-hydroxy acid derivatives. ac-3-Hydroxyheptanoic acid is also found in milk, where it resulted as a product of degradation or fatty acid synthesis. | | Definition | ChEBI: 3-hydroxyheptanoic acid is a 3-hydroxy fatty acid that is heptanoic acid in which one of the hydrogens at position 3 is replaced by a hydroxy group. It is a 3-hydroxy fatty acid and a medium-chain fatty acid. It is functionally related to a heptanoic acid. |
| | 3-HYDROXYHEPTANOIC ACID Preparation Products And Raw materials |
|