|
|
| | 6-TAMRA Basic information |
| Product Name: | 6-TAMRA | | Synonyms: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylicacid, 3',6'-bis(dimethylamino)-3-oxo-;3',6'-Bis(dimethylamino)-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-6-carboxylic acid;6-TAMRA TEA salt;6-TAMRA (free acid);3',6'-Bis(dimethylamino)-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-6-carboxylic acid;3',6'-Bis(dimethylamino)-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-6-carboxylic acid | | CAS: | 150322-06-8 | | MF: | C25H22N2O5 | | MW: | 430.45 | | EINECS: | | | Product Categories: | | | Mol File: | 150322-06-8.mol |  |
| | 6-TAMRA Chemical Properties |
| Boiling point | 702.7±60.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | solubility | DMSO: soluble | | pka | 3.55±0.20(Predicted) | | form | Solid | | color | Red | | Stability: | Light Sensitive, Moisture Sensitive | | InChI | InChI=1S/C25H22N2O5/c1-26(2)15-6-9-18-21(12-15)31-22-13-16(27(3)4)7-10-19(22)25(18)20-11-14(23(28)29)5-8-17(20)24(30)32-25/h5-13H,1-4H3,(H,28,29) | | InChIKey | AIOHJULCHGRPMK-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=C(N(C)C)C=C3)OC3=C1C=CC(N(C)C)=C3)C1=C(C=CC(C(O)=O)=C1)C(=O)O2 |
| | 6-TAMRA Usage And Synthesis |
| Uses | A fluoresent compound. |
| | 6-TAMRA Preparation Products And Raw materials |
|