| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
5-Carboxytetramethylrhodamine manufacturers
|
| | 5-Carboxytetramethylrhodamine Basic information |
| Product Name: | 5-Carboxytetramethylrhodamine | | Synonyms: | 3',6'-Bis(dimethylamino)-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-5-carboxylic acid;Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-5-carboxylicacid, 3',6'-bis(dimethylamino)-3-oxo-;3-carboxy-4-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]benzoate;3’,6’-Bis(dimethylamino)-3-oxo-3H-spiro[isobenzofuran-1,9’-xanthene]-5-carboxylic Acid;3',6'-Bis(dimethylamino)-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-5-carboxylic acid , 5-Carboxytetramethylrhodamine | | CAS: | 150322-05-7 | | MF: | C25H22N2O5 | | MW: | 430.45 | | EINECS: | | | Product Categories: | Fluorescent Labels and Indicators;Fluorescent Labels & Indicators | | Mol File: | 150322-05-7.mol |  |
| | 5-Carboxytetramethylrhodamine Chemical Properties |
| Boiling point | 694.4±55.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: soluble | | pka | 3.76±0.20(Predicted) | | form | Solid | | color | Brown to breen | | InChI | InChI=1S/C25H22N2O5/c1-26(2)15-6-9-19-21(12-15)31-22-13-16(27(3)4)7-10-20(22)25(19)18-8-5-14(23(28)29)11-17(18)24(30)32-25/h5-13H,1-4H3,(H,28,29) | | InChIKey | DCVXPZDNLDPUES-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=C(N(C)C)C=C3)OC3=C1C=CC(N(C)C)=C3)C1=C(C=C(C(O)=O)C=C1)C(=O)O2 |
| | 5-Carboxytetramethylrhodamine Usage And Synthesis |
| Uses | A long-wavelength dye |
| | 5-Carboxytetramethylrhodamine Preparation Products And Raw materials |
|