| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 4-METHOXYAZOBENZENE
-
- $1.00
-
2019-07-06
- CAS:2396-60-3
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 100kg
|
| | 4-Methoxyazobenzene Basic information |
| Product Name: | 4-Methoxyazobenzene | | Synonyms: | (4-methoxyphenyl)-phenyl-diazene;4-Methoxyazobenzene,97%;PARA-METHOXYAZOBENZENE;METHOXYAZOBENZENE;4-METHOXYAZOBENZENE 97%;p-METHOXYAZOBENZENE extrapure AR;1-(4-Methoxyphenyl)-2-phenyldiazene;NSC 16044 | | CAS: | 2396-60-3 | | MF: | C13H12N2O | | MW: | 212.25 | | EINECS: | 219-250-9 | | Product Categories: | | | Mol File: | 2396-60-3.mol |  |
| | 4-Methoxyazobenzene Chemical Properties |
| Melting point | 54-56 °C | | Boiling point | 340 °C | | density | 1.1200 | | refractive index | 1.6920 (estimate) | | form | powder to crystal | | color | Light yellow to Brown | | BRN | 958054 | | InChI | 1S/C13H12N2O/c1-16-13-9-7-12(8-10-13)15-14-11-5-3-2-4-6-11/h2-10H,1H3/b15-14+ | | InChIKey | LGCRPKOHRIXSEG-CCEZHUSRSA-N | | SMILES | COc1ccc(cc1)\N=N\c2ccccc2 | | CAS DataBase Reference | 2396-60-3(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2927.00.5000 | | Storage Class | 11 - Combustible Solids |
| | 4-Methoxyazobenzene Usage And Synthesis |
| Purification Methods | Crystallise 4-methoxyazobenzene from EtOH. [Beilstein 16 IV 162.] |
| | 4-Methoxyazobenzene Preparation Products And Raw materials |
|