|
|
| | 4,4'-DIETHYNYLBIPHENYL Basic information |
| Product Name: | 4,4'-DIETHYNYLBIPHENYL | | Synonyms: | 1-ethynyl-4-(4-ethynylphenyl)benzene;(Biphenyl-4,4'-diyl)bisacetylene;4,4'-Di(ethynyl)-1,1'-biphenyl;4,4'-Diethynylphenyl;4,4'-Diacetylenebiphenyl;1,1'-Biphenyl,4,4'-diethynyl-;4,4'-Diethynylbiphenyl>;4,4'-Diethynylbiphenyl | | CAS: | 38215-38-2 | | MF: | C16H10 | | MW: | 202.25 | | EINECS: | | | Product Categories: | | | Mol File: | 38215-38-2.mol |  |
| | 4,4'-DIETHYNYLBIPHENYL Chemical Properties |
| Melting point | 172-173℃ | | Boiling point | 318.2±35.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C16H10/c1-3-13-5-9-15(10-6-13)16-11-7-14(4-2)8-12-16/h1-2,5-12H | | InChIKey | MXJJMQSKDPNPSX-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C#C)C=C2)=CC=C(C#C)C=C1 |
| | 4,4'-DIETHYNYLBIPHENYL Usage And Synthesis |
| | 4,4'-DIETHYNYLBIPHENYL Preparation Products And Raw materials |
| Raw materials | 1,1'-Biphenyl, 4,4'-bis[2-(trimethylsilyl)ethynyl]--->Silane, [1,1'-biphenyl]-4,4'-diylbis[trimethyl--->4,4'-Diacetylbiphenyl-->TRIBUTYLSTANNYLACETYLENE-->4,4'-Dibromobiphenyl-->Diethyl ether-->4,4'-Diiodobiphenyl-->Biphenyl-->Trimethylsilylacetylene | | Preparation Products | 4,4'-Divinylbiphenyl |
|