| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 4,4'-Diiodobiphenyl
-
-
2026-09-07
- CAS:3001-15-8
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 2000KGS
- 4,4'-Diiodobiphenyl
-
- $10.00
-
2026-03-20
- CAS:3001-15-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | 4,4'-Diiodobiphenyl Basic information |
| Product Name: | 4,4'-Diiodobiphenyl | | Synonyms: | 4-(4'-IODOPHENYL)IODOBENZENE;4,4'-DIODOBIPHENYL;4,4'-Diiodobiphenyl (DIB);4,4''-DIIODOBIPHENYL 98%;4,4-DIIODOBIPHENYL 99.5%;1,1'-Biphenyl, 4,4'-diiodo-;4,4’-diiodo-1’-biphenyl;Biphenyl, 4,4'-diiodo | | CAS: | 3001-15-8 | | MF: | C12H8I2 | | MW: | 406 | | EINECS: | 221-080-5 | | Product Categories: | Biphenyl derivatives;pharmacetical;Liquid Crystal intermediates;Miscellaneous;Biphenyls (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;White to light yellow crystalline powder;Aryl;C9 to C12;Pyridines;Halogenated Hydrocarbons | | Mol File: | 3001-15-8.mol |  |
| | 4,4'-Diiodobiphenyl Chemical Properties |
| Melting point | 201-204 °C(lit.) | | Boiling point | 380.9±35.0 °C(Predicted) | | density | 2.041±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in hot Toluene(very faint turbidity). | | form | Powder | | color | Pale yellow to beige | | Sensitive | Light Sensitive | | InChI | InChI=1S/C12H8I2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H | | InChIKey | GPYDMVZCPRONLW-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(I)C=C2)=CC=C(I)C=C1 | | CAS DataBase Reference | 3001-15-8(CAS DataBase Reference) | | NIST Chemistry Reference | 4,4'-Diiododiphenyl(3001-15-8) | | EPA Substance Registry System | 1,1'-Biphenyl, 4,4'-diiodo- (3001-15-8) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-37/38-36-36/37/38 | | Safety Statements | 36-37-26 | | RIDADR | UN 3152 9/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | II | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | 4,4'-Diiodobiphenyl Usage And Synthesis |
| Chemical Properties | Crystalline powder | | Uses | suzuki reaction | | Uses | 4,4-diiodobiphenyl was coupled with (trimethylsilyl) acetylene via a Sonogashira-Hagihara reaction to afford the (trimethylsilyl)ethynyl derivative. 4,4-diiodobipheny enhanced the expression of the luciferase gene. | | Uses | Intermediates of Liquid Crystals |
| | 4,4'-Diiodobiphenyl Preparation Products And Raw materials |
| Raw materials | Benzene, 1-iodo-4-(trimethylsilyl)--->3,3'-BIANISOLE-->4-Iodobenzenesulfonohydrazide-->2-(3-methoxyphenyl)-5, 5-dimethyl-1,3,2-dioxaborinane-->3-Methoxyphenylboronic Acid Pinacol Ester | | Preparation Products | N,N,N',N'-Tetraphenylbenzidine-->4-Iodobiphenyl-->1,4-Benzenedipropanal-->1-Chloro-4-iodobenzene-->PYRIDINE, 4,4'-[1,1'-BIPHENYL]-4,4'-DIYLBIS--->Biphenyl-4,4'-dithiol-->4,4'-Diethynylbiphenyl-->N,N'-Di-(4-methyl-phenyl)-benzidine |
|