3-CARBOMETHOXY-2-PYRONE manufacturers
|
| | 3-CARBOMETHOXY-2-PYRONE Basic information |
| Product Name: | 3-CARBOMETHOXY-2-PYRONE | | Synonyms: | 3-CARBOMETHOXY-2-PYRONE;METHYL 2-OXO-2 H-PYRAN-3-CARBOXYLATE;METHYL 2-PYRONE-3-CARBOXYLATE;METHYL 2-OXO-2H-PYRAN-3-CARBOXYLATE, 99+ %;3-CARBOMETHOXY-2-PYRONE 99%;3-Carbomethoxy-2-pyrone,99%;Methyl 2-oxo-2H-pyran-3-carboxylate 98%;2-Oxo-2H-pyran-3-carboxylic acid methyl ester | | CAS: | 25991-27-9 | | MF: | C7H6O4 | | MW: | 154.12 | | EINECS: | 247-397-9 | | Product Categories: | API intermediates | | Mol File: | 25991-27-9.mol |  |
| | 3-CARBOMETHOXY-2-PYRONE Chemical Properties |
| Melting point | 75-77 °C (lit.) | | Boiling point | 146-148 °C/0.75 mmHg (lit.) | | density | 1.1993 (rough estimate) | | refractive index | 1.4300 (estimate) | | Fp | 146-148°C/0.75mm | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | Appearance | Light yellow to yellow Solid | | BRN | 1424749 | | InChI | InChI=1S/C7H6O4/c1-10-6(8)5-3-2-4-11-7(5)9/h2-4H,1H3 | | InChIKey | GJVZWOMUTYNUCE-UHFFFAOYSA-N | | SMILES | C1(=O)OC=CC=C1C(OC)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 21 | | HS Code | 2932209090 | | Storage Class | 11 - Combustible Solids |
| | 3-CARBOMETHOXY-2-PYRONE Usage And Synthesis |
| Chemical Properties | LIGHT YELLOW CRYSTALLINE SOLID | | Uses | Methyl 2-oxo-2H-pyran-3-carboxylate is used as a reagent to investigate alfa, beta-unsaturated carbonyl compounds for their cytotoxic profiles against oral human normal and tumor cells. | | General Description | Methyl 2-oxo-2H-pyran-3-carboxylate is a cyclic α,β -unsaturated ketone. It activates caspases-3, -8 and -9 weakly in HL-60 cells. |
| | 3-CARBOMETHOXY-2-PYRONE Preparation Products And Raw materials |
|