|
|
| | L-Tyrosine-beta-13C Basic information |
| | L-Tyrosine-beta-13C Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | density | 1.334±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | Optical Rotation | [α]20/D -10.6°, c =4 in 1 M HCl | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i5+1 | | InChIKey | OUYCCCASQSFEME-LDSMRRTFSA-N | | SMILES | OC1=CC=C([13CH2][C@H](N)C(O)=O)C=C1 | | CAS Number Unlabeled | 60-18-4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | L-Tyrosine-beta-13C Usage And Synthesis |
| | L-Tyrosine-beta-13C Preparation Products And Raw materials |
|