| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | DL-Tyrosine-beta-13C Basic information |
| Product Name: | DL-Tyrosine-beta-13C | | Synonyms: | DL-TYROSINE-BETA-13C, 98 ATOM % 13C;98atom%13c;dl-4-hydroxyphenyl(alanine-3-13c);dl-tyrosine-3-13c;DL-Tyrosine-3-13C;DL-Tyrosine-beta-13C | | CAS: | 93627-94-2 | | MF: | C9H11NO3 | | MW: | 182.18 | | EINECS: | | | Product Categories: | | | Mol File: | 93627-94-2.mol |  |
| | DL-Tyrosine-beta-13C Chemical Properties |
| Melting point | >300 °C (dec.) (lit.) | | density | 1.334±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/i5+1 | | InChIKey | OUYCCCASQSFEME-HOSYLAQJSA-N | | SMILES | NC([13CH2]c1ccc(O)cc1)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-Tyrosine-beta-13C Usage And Synthesis |
| | DL-Tyrosine-beta-13C Preparation Products And Raw materials |
|