| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1H,1H-Perfluorooctylamine manufacturers
|
| | 1H,1H-Perfluorooctylamine Basic information |
| Product Name: | 1H,1H-Perfluorooctylamine | | Synonyms: | 1H,1H-Perfluorooctylamine 97%;1H,1H-Perfluorooctylamine97%;1H,1H-PENTADECAFLUOROOCTYLAMINE;1H,1H-PERFLUOROOCTYLAMINE;RARECHEM AL BW 0455;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctan-1-amine;(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctyl)amine;2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctylamine | | CAS: | 307-29-9 | | MF: | C8H4F15N | | MW: | 399.1 | | EINECS: | 671-163-9 | | Product Categories: | | | Mol File: | 307-29-9.mol |  |
| | 1H,1H-Perfluorooctylamine Chemical Properties |
| Melting point | 240-245 °C (decomp) | | Boiling point | 75 °C | | density | 1,714 g/cm3 | | refractive index | 1.305 | | Fp | 75°C/50mm | | storage temp. | 2-8°C, protect from light | | form | solid | | pka | 6.05±0.30(Predicted) | | Specific Gravity | 1.714 | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Not miscible or difficult to mix in water. | | BRN | 1806966 | | InChI | 1S/C8H4F15N/c9-2(10,1-24)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h1,24H2 | | InChIKey | HZCZXRSVKNFILZ-UHFFFAOYSA-N | | SMILES | NCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 307-29-9(CAS DataBase Reference) | | EPA Substance Registry System | 1H,1H-Perfluorooctylamine (307-29-9) |
| Hazard Codes | C,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | RIDADR | UN2735 | | WGK Germany | WGK 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29211990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Dam. 1
Lact.
Repr. 1B
STOT RE 1 |
| | 1H,1H-Perfluorooctylamine Usage And Synthesis |
| Uses | 1H,1H-Perfluorooctylamine is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. |
| | 1H,1H-Perfluorooctylamine Preparation Products And Raw materials |
|