| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)aniline
-
- $1.00
-
2020-01-10
- CAS:83766-52-3
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | 4-(Heptadecafluorooctyl)aniline Basic information |
| Product Name: | 4-(Heptadecafluorooctyl)aniline | | Synonyms: | 4-Perfluorooctylaniline;4-(Heptadecafluorooctyl)aniline;4-(Heptadecafluorooctyl)aniline >=95.0% (GC);4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)aniline;4-(Heptadecafluorooc;Benzenamine, 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)- | | CAS: | 83766-52-3 | | MF: | C14H6F17N | | MW: | 511.18 | | EINECS: | | | Product Categories: | Naphthyridine,Quinoline | | Mol File: | 83766-52-3.mol |  |
| | 4-(Heptadecafluorooctyl)aniline Chemical Properties |
| Melting point | 40-45 °C | | form | solid | | InChI | 1S/C14H6F17N/c15-7(16,5-1-3-6(32)4-2-5)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h1-4H,32H2 | | InChIKey | ZQTZVMUNYIDMJV-UHFFFAOYSA-N | | SMILES | NC1=CC=C(C(F)(C(F)(C(F)(C(F)(C(F)(C(F)(C(F)(C(F)(F)F)F)F)F)F)F)F)F)C=C1 | | EPA Substance Registry System | 4-(Perfluorooctyl)aniline (83766-52-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10-34 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |
| | 4-(Heptadecafluorooctyl)aniline Usage And Synthesis |
| Uses | 4-(Heptadecafluorooctyl)aniline was used in the synthesis of fluorous (S)-pyrrolidine-thiourea bifunctional organocatalyst. |
| | 4-(Heptadecafluorooctyl)aniline Preparation Products And Raw materials |
|