|
|
| | 4-Chloro-3-methylphenol-2,6-d2 Basic information |
| Product Name: | 4-Chloro-3-methylphenol-2,6-d2 | | Synonyms: | 4-CHLORO-3-METHYLPHENOL (RING-2,6-D2);4-CHLORO-3-METHYLPHENOL-2,6-D2, 98 ATOM&;4-chloro-m-cresol-2,6-d2;4-Chloro-3-Methylphenol-d2;4-Chloro-3-methylphenol-2,6-d2 in isopropanol;4-Chloro-3-methylphenol-2,6-d2;4-Chloro-3-methylphenol D2 (2,6-D2);4-Chloro-3-methylphenol (ring-2,6-D?, 98%) | | CAS: | 93951-72-5 | | MF: | C7H7ClO | | MW: | 142.58 | | EINECS: | | | Product Categories: | | | Mol File: | 93951-72-5.mol |  |
| | 4-Chloro-3-methylphenol-2,6-d2 Chemical Properties |
| Melting point | 63-65 °C(lit.) | | Boiling point | 235 °C(lit.) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Very Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C7H7ClO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3/i2D,4D | | InChIKey | CFKMVGJGLGKFKI-XRIVEGAOSA-N | | SMILES | [2H]c1cc(Cl)c(C)c([2H])c1O | | EPA Substance Registry System | 4-Chloro-3-methylphenol-d2 (93951-72-5) | | CAS Number Unlabeled | 59-50-7 |
| Hazard Codes | Xn,N | | Risk Statements | 21/22-41-43-50 | | Safety Statements | 26-36/37/39-61 | | RIDADR | UN 3437 6.1/PG 2 | | WGK Germany | 2 | | RTECS | GO7100000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 3
Eye Dam. 1
Skin Corr. 1C
Skin Sens. 1B
STOT SE 3 |
| | 4-Chloro-3-methylphenol-2,6-d2 Usage And Synthesis |
| Uses | 4-Chloro-3-methylphenol-2,6-d2 (CAS# 93951-72-5) is the labelled version of 4-Chloro-3-methylphenol (C369765(P)), which is a ryanodine receptor activator. |
| | 4-Chloro-3-methylphenol-2,6-d2 Preparation Products And Raw materials |
|