|
|
| | SULFAMOXOL Basic information |
| Product Name: | SULFAMOXOL | | Synonyms: | 4-AMINO-N-(4,5-DIMETHYL-2-OXAZOLYL)BENZENESULFONAMIDE;2-(p-Aminobenzenesulfonamido)-4,5-dimethyloxazole;2-(p-Aminobenzolsulfonamido)-4,5-dimethyloxazol;2-(p-aminophenylsulfonylamino)-4,5-dimethyl-oxazol;4,5-Dimethyl-2-sulfanilamidooxazole;4-Amino-N-(4,5-dimethyl-1,3-oxazol-2-yl)benzenesulfonamide;4-amino-n-(4,5-dimethyl-2-oxazolyl)-benzenesulfonamid;Benzenesulfonamide, 4-amino-N-(4,5-dimethyl-2-oxazolyl)- | | CAS: | 729-99-7 | | MF: | C11H13N3O3S | | MW: | 267.3 | | EINECS: | 211-982-7 | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Sulfur & Selenium Compounds | | Mol File: | 729-99-7.mol |  |
| | SULFAMOXOL Chemical Properties |
| Melting point | 197-199℃ | | Boiling point | 481.0±47.0 °C(Predicted) | | density | 1.3786 g/cm3 | | refractive index | 1.6630 (estimate) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | pKa 7.40 (Uncertain) | | color | Off-White to Pale Yellow | | Water Solubility | 961mg/L(20 ºC) | | Merck | 13,9009 | | BRN | 248434 | | InChI | InChI=1S/C11H13N3O3S/c1-7-8(2)17-11(13-7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6H,12H2,1-2H3,(H,13,14) | | InChIKey | CYFLXLSBHQBMFT-UHFFFAOYSA-N | | SMILES | C1(S(NC2=NC(C)=C(C)O2)(=O)=O)=CC=C(N)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 2 | | RTECS | WO9150000 | | Toxicity | LD50 in mice, rats (g/kg): >10.0, >12.5 orally; 1.80, ~2.50 i.p. (Lagler) |
| | SULFAMOXOL Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Silversulfadiazine and Sulfamoxol are common drugs in treatment of bacterial disease. | | Definition | ChEBI: A sulfonamide antibiotic in which 4-aminobenzenesulfonic acid and 4,5-dimethyl-1,3-oxazol-2-amine have combined to form the sulfonamide bond. |
| | SULFAMOXOL Preparation Products And Raw materials |
|