| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Z-GLN-GLY-OH manufacturers
- Z-GLN-GLY-OH
-
- $7.00
-
2020-02-19
- CAS: 6610-42-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | Z-GLN-GLY-OH Basic information |
| | Z-GLN-GLY-OH Chemical Properties |
| Melting point | 131 - 132°C | | Boiling point | 748.0±60.0 °C(Predicted) | | density | 1.339 | | storage temp. | -20°C | | solubility | Chloroform (Slightly, Sonicated) Methanol (Slightly), Water (Slightly, Sonicated | | form | Solid | | pka | 3.38±0.10(Predicted) | | color | White to Off-White | | Optical Rotation | -3.9°(C=1.1658g/mL, DMF, 20°C, 589nm) | | InChI | 1S/C15H19N3O6/c16-12(19)7-6-11(14(22)17-8-13(20)21)18-15(23)24-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H2,16,19)(H,17,22)(H,18,23)(H,20,21) | | InChIKey | SOUXAAOTONMPRY-UHFFFAOYSA-N | | SMILES | NC(=O)CCC(NC(=O)OCc1ccccc1)C(=O)NCC(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Z-GLN-GLY-OH Usage And Synthesis |
| Uses | γ-Glutamyl donor substrate used in spectrophotometric determination of transglutaminase (TGase) activity. Z-Gln-Gly was used to enzymatically synthesize N-linked neoglycoproteins. | | Biochem/physiol Actions | N-Benzyloxycarbonyl-L-Glutaminylglycine (Z-Gln-Gly, Z-QG) is used as a substrate to differentiate and characterize transglutaminase(s) (TGase) that catalyzes the post-translational covalent cross-linking of Gln- and Lys-containing peptides. Z-QG supports glutamyl-level cross-linking applications thruough surface modification. |
| | Z-GLN-GLY-OH Preparation Products And Raw materials |
|