3-CHLORO-6-FLUOROBENZO(B)THIOPHENE-2-CA& manufacturers
|
| | 3-CHLORO-6-FLUOROBENZO(B)THIOPHENE-2-CA& Basic information |
| | 3-CHLORO-6-FLUOROBENZO(B)THIOPHENE-2-CA& Chemical Properties |
| Melting point | 293-297 °C(lit.) | | Boiling point | 398.2±37.0 °C(Predicted) | | density | 1.627±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 2.19±0.30(Predicted) | | form | solid | | Appearance | Yellow to brown Solid | | InChI | InChI=1S/C9H4ClFO2S/c10-7-5-2-1-4(11)3-6(5)14-8(7)9(12)13/h1-3H,(H,12,13) | | InChIKey | HSRSWUJIPYUCSE-UHFFFAOYSA-N | | SMILES | C12=CC(F)=CC=C1C(Cl)=C(C(O)=O)S2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | 3-CHLORO-6-FLUOROBENZO(B)THIOPHENE-2-CA& Usage And Synthesis |
| | 3-CHLORO-6-FLUOROBENZO(B)THIOPHENE-2-CA& Preparation Products And Raw materials |
|