| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Methyl 3-chloro-6-fluorobenzo(b)thiophe& manufacturers
|
| | Methyl 3-chloro-6-fluorobenzo(b)thiophe& Basic information |
| | Methyl 3-chloro-6-fluorobenzo(b)thiophe& Chemical Properties |
| Melting point | 119-123 °C(lit.) | | form | solid | | InChI | 1S/C10H6ClFO2S/c1-14-10(13)9-8(11)6-3-2-5(12)4-7(6)15-9/h2-4H,1H3 | | InChIKey | GBCJKOYCWCNSAF-UHFFFAOYSA-N | | SMILES | COC(=O)c1sc2cc(F)ccc2c1Cl |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids |
| | Methyl 3-chloro-6-fluorobenzo(b)thiophe& Usage And Synthesis |
| | Methyl 3-chloro-6-fluorobenzo(b)thiophe& Preparation Products And Raw materials |
|