| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-(Bromomethyl)-2,4, 10-trioxaadamantane Basic information |
| Product Name: | 3-(Bromomethyl)-2,4, 10-trioxaadamantane | | Synonyms: | BROMO(2,3, 10-TRIOXATRICYCLO[3.3.1.1(3.7)]DEC-3-YL)METHANE;3-(BROMOMETHYL)-2,4, 10-TRIOXATRICYCLO[3.3.1.1(3.7)]DECANE;3-(bromomethyl)-2,4,10-trioxatricyclo(3. 3.1.1(3)(.)(7))dec.;3-(Bromomethyl)-2,4,10-trioxaadmantane;2,4,10-Trioxatricyclo3.3.1.13,7decane, 3-(bromomethyl)-;3-(Bromomethyl)-2,4,10-trioxatricyclo[3.3.1.13.7]decane, Bromo(2,3,10-trioxatricyclo[3.3.1.13.7]dec-3-yl)methane;3-(Bromomethyl)-2,4,10-trioxaadamantane, Bromo(2,3,10-trioxatricyclo[3.3.1.13.7]dec-3-yl)methane;3-(Bromomethyl)-2,4,10-trioxatricyclo[3.3.1.13.7]decane | | CAS: | 157371-80-7 | | MF: | C8H11BrO3 | | MW: | 235.08 | | EINECS: | | | Product Categories: | | | Mol File: | 157371-80-7.mol |  |
| | 3-(Bromomethyl)-2,4, 10-trioxaadamantane Chemical Properties |
| Melting point | 95-97 °C | | storage temp. | 2-8°C | | solubility | Chloroform, DCM, Ethyl Acetate, Methanol | | form | Solid | | color | White | | InChI | 1S/C8H11BrO3/c9-4-8-10-5-1-6(11-8)3-7(2-5)12-8/h5-7H,1-4H2/t5-,6+,7-,8+ | | InChIKey | CSXFBEUWUQOEEC-KVFPUHGPSA-N | | SMILES | BrCC12O[C@H]3C[C@H](C[C@H](C3)O1)O2 |
| | 3-(Bromomethyl)-2,4, 10-trioxaadamantane Usage And Synthesis |
| Uses | 3-(Bromomethyl)-2,4,10-trioxatricyclo[3.3.1.13.7]decane may be used in the chemical synthesis studies. |
| | 3-(Bromomethyl)-2,4, 10-trioxaadamantane Preparation Products And Raw materials |
|