- N-METHYL-P-TOLUIDINE
-
- $1.10
-
2026-08-20
- CAS:623-08-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
- N-METHYL-P-TOLUIDINE
-
- $10.00
-
2026-03-20
- CAS:623-08-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | N-Methyl-p-toluidine Basic information |
| Product Name: | N-Methyl-p-toluidine | | Synonyms: | n,4-dimethyl-benzenamin;N,4-Dimethylbenzenamine;N,p-Dimethylaniline;N-Methyl-4-methylaniline;p,N-Dimethylaniline;p-Toluidine, N-methyl-;N-METHYL-P-TOLUIDIN;7 N-Methyl-p-Toluidine | | CAS: | 623-08-5 | | MF: | C8H11N | | MW: | 121.18 | | EINECS: | 210-769-6 | | Product Categories: | Amines;C8;Nitrogen Compounds;A | | Mol File: | 623-08-5.mol |  |
| | N-Methyl-p-toluidine Chemical Properties |
| Melting point | -10.08°C (estimate) | | Boiling point | 212 °C(lit.) | | density | 0.958 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.557(lit.) | | Fp | 183 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 5.26±0.12(Predicted) | | form | clear liquid | | color | Colorless to Orange to Green | | InChI | InChI=1S/C8H11N/c1-7-3-5-8(9-2)6-4-7/h3-6,9H,1-2H3 | | InChIKey | QCIFLGSATTWUQJ-UHFFFAOYSA-N | | SMILES | C1(NC)=CC=C(C)C=C1 | | CAS DataBase Reference | 623-08-5(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, N,4-dimethyl- (623-08-5) |
| Hazard Codes | T | | Risk Statements | 23/24/25-33-52/53 | | Safety Statements | 28-36/37-45-61-28A | | RIDADR | UN 2810 6.1/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1(a) | | PackingGroup | II | | HS Code | 29214300 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Chronic 3
STOT RE 2 |
| | N-Methyl-p-toluidine Usage And Synthesis |
| Chemical Properties | CLEAR YELLOW TO BROWN LIQUID | | Uses | N-Methyl-p-toluidine is an aromatic secondary amine. It forms social isomers when encapsulated with a molecule of chloroform or benzene in a cylindrical capsule. 2-amino-4,6-dichloropyrimidine-5-carbaldehyde undergoes mono-amination with N-methyl-p-toluidine to form a precursor for the preparation of pyrazolo[3,4-d]pyrimidines. It annelates with dimethyl acetylenedicarboxylate via formation of toluidine radical cation intermediate. | | General Description | N-Methyl-p-toluidine is an aromatic secondary amine. It forms social isomers when encapsulated with a molecule of chloroform or benzene in a cylindrical capsule. 2-amino-4,6-dichloropyrimidine-5-carbaldehyde undergoes mono-amination with N-methyl-p-toluidine to form a precursor for the preparation of pyrazolo[3,4-d]pyrimidines. It annelates with dimethyl acetylenedicarboxylate via formation of toluidine radical cation intermediate. |
| | N-Methyl-p-toluidine Preparation Products And Raw materials |
|