|
|
| | 4'-FLUORO[1,1'-BIPHENYL]-4-SULFONYL CHLORIDE Basic information |
| | 4'-FLUORO[1,1'-BIPHENYL]-4-SULFONYL CHLORIDE Chemical Properties |
| Melting point | 82 °C | | Boiling point | 372.9±25.0 °C(Predicted) | | density | 1.384±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | solid | | Appearance | White to off-white Solid | | Sensitive | Moisture Sensitive | | InChI | 1S/C12H8ClFO2S/c13-17(15,16)12-7-3-10(4-8-12)9-1-5-11(14)6-2-9/h1-8H | | InChIKey | CIDMHDJTWVMBIF-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1)-c2ccc(cc2)S(Cl)(=O)=O | | CAS DataBase Reference | 116748-66-4(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 14-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | HazardClass | 8 | | HS Code | 2904990090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4'-FLUORO[1,1'-BIPHENYL]-4-SULFONYL CHLORIDE Usage And Synthesis |
| | 4'-FLUORO[1,1'-BIPHENYL]-4-SULFONYL CHLORIDE Preparation Products And Raw materials |
|