| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,3-Dinitrophenol Basic information |
| Product Name: | 2,3-Dinitrophenol | | Synonyms: | 2,3-Dinitrofenol;2,3-dinitro-pheno;2,3-dinitrophenolmoistenedwithwater(h2o~20%);2,3-dnp;Phenol, 2,3-dinitro-;Dinitrophenol, 2,3-;2,3-Dinitrophenol moistened with water, >=98.0% (HPLC);Nsc 156083 | | CAS: | 66-56-8 | | MF: | C6H4N2O5 | | MW: | 184.11 | | EINECS: | 200-628-7 | | Product Categories: | Nitro;Organic Building Blocks;Oxygen Compounds;Phenols | | Mol File: | 66-56-8.mol |  |
| | 2,3-Dinitrophenol Chemical Properties |
| Melting point | 141-145 °C | | Boiling point | 329℃ | | density | 1.650 | | refractive index | 1.4738 (estimate) | | Fp | 151℃ | | solubility | Solubility Sparingly soluble in water; soluble in ethanol, ether | | pka | 4.86, 4.96(at 25℃) | | color | Yellow needles | | PH Range | Colorless (3.9) to yellow (5.9) | | BRN | 2213580 | | Major Application | For biosensor design, drug delivery | | InChI | 1S/C6H4N2O5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H | | InChIKey | MHKBMNACOMRIAW-UHFFFAOYSA-N | | SMILES | Oc1cccc(c1[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 66-56-8 | | EPA Substance Registry System | Phenol, 2,3-dinitro- (66-56-8) |
| Hazard Codes | T,N | | Risk Statements | 23/24/25-33-51/53 | | Safety Statements | 28-37-45-61 | | RIDADR | UN 1320 4.1/PG 1 | | WGK Germany | 3 | | RTECS | SL2700000 | | HazardClass | 4.1 | | PackingGroup | I | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 Expl. 1.1 STOT RE 2 |
| | 2,3-Dinitrophenol Usage And Synthesis |
| Chemical Properties | Yellow monoclinic prisms, flammable. Soluble in ether, benzene, and ethanol;
slightly soluble in water. | | Uses | 2,3-Dinitrophenol may be employed as nitrogen supplement for the bacterial culture medium. | | Definition | ChEBI: 2,3-dinitrophenol is a dinitrophenol. | | General Description | 2,3-Dinitrophenol is a nitroaromatic compound. It has been reported to exhibit high acute toxicity to Scenedesmus obliquus, with EC50 value of 2.5±0.8. |
| | 2,3-Dinitrophenol Preparation Products And Raw materials |
|