|
|
| | 2-CHLORO-4,6-DINITROPHENOL Basic information |
| | 2-CHLORO-4,6-DINITROPHENOL Chemical Properties |
| Melting point | 110-114 °C (lit.) | | InChI | 1S/C6H3ClN2O5/c7-4-1-3(8(11)12)2-5(6(4)10)9(13)14/h1-2,10H | | InChIKey | PCBCIXWBAPIVDV-UHFFFAOYSA-N | | SMILES | Oc1c(Cl)cc(cc1[N+]([O-])=O)[N+]([O-])=O | | CAS DataBase Reference | 946-31-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 3335 | | WGK Germany | 2 | | RTECS | SK4200000 | | HS Code | 2908990000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-CHLORO-4,6-DINITROPHENOL Usage And Synthesis |
| Uses | 2-Chloro-4,6-dinitrophenol was used in identification of components in chemical waste water and in effluents from biological wastewater treatment plant using electrospray ionization and tandem mass spectrometry. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 27, p. 575, 1990 DOI: 10.1002/jhet.5570270318 | | General Description | 2-Chloro-4,6-dinitrophenol was added as nitrogen, carbon and energy supplement in the culture medium of Rhodococcus erythropolis HL 24-1. |
| | 2-CHLORO-4,6-DINITROPHENOL Preparation Products And Raw materials |
|