| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:2,3,6-Trinitrophenol
CAS:603-10-1
Purity:Moistened with water, >=95.0% (calc. based on dry substance, HPLC) Package:1G
|
| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:2,3,6-TRINITROPHENOL
CAS:603-10-1
Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
| Company Name: |
Suzhou yacoo science co.,Ltd
|
| Tel: |
0512-87182056 18013166090 |
| Email: |
lingling.qi@yacoo.com.cn |
| Products Intro: |
Product Name:2,3,6-TRINITROPHENOL
CAS:603-10-1
Purity: Package:10g;50g;1kg;5Kg;25kg;
|
|
| | 2,3,6-TRINITROPHENOL Basic information |
| Product Name: | 2,3,6-TRINITROPHENOL | | Synonyms: | 2,3,6-TRINITROPHENOL;2,3,6-trinitrophenol moistened with water (H2O ~40%);2,3,6-TRINITROPHENOL (WITH 0,4 ML H2O/G);2,3,6-Trinitrophenol moistened with water, >=95.0% (calc. based on dry substance, HPLC);Phenol, 2,3,6-trinitro- | | CAS: | 603-10-1 | | MF: | C6H3N3O7 | | MW: | 229.1 | | EINECS: | 625-670-7 | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Phenols | | Mol File: | 603-10-1.mol |  |
| | 2,3,6-TRINITROPHENOL Chemical Properties |
| Melting point | 119-120 °C(lit.) | | InChI | 1S/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H | | InChIKey | UPOHJPYGIYINKG-UHFFFAOYSA-N | | SMILES | Oc1c(ccc(c1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O |
| Hazard Codes | F,T | | Risk Statements | 1-4-11-24/25 | | Safety Statements | 7-16-35-45 | | RIDADR | UN 1344 4.1/PG 1 | | WGK Germany | 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Flam. Sol. 2 |
| | 2,3,6-TRINITROPHENOL Usage And Synthesis |
| Uses | 2,3,6-Trinitrophenol is a useful reactant and reagent in organic reactions. | | Definition | ChEBI: 2,3,6-trinitrophenol is phenol substituted with nitro groups at both ortho-positions and at the meta-position. It is functionally related to a phenol. |
| | 2,3,6-TRINITROPHENOL Preparation Products And Raw materials |
|