| Company Name: |
LGM Pharma |
| Tel: |
1-(800)-881-8210 |
| Email: |
inquiries@lgmpharma.com |
|
| | Hydroxyzine pamoate Basic information |
| Product Name: | Hydroxyzine pamoate | | Synonyms: | HYDROXYZINE PAMOATE SALT;hydroxyzine embonate;HYDROXYZINEPAMOATE,USP;1-(p-Chloro-α-phenylbenzyl)-4-(2-hydroxyethoxyethyl)piperazine, pamoate;2-Naphthalenecarboxylic acid, 4,4'-methylenebis[3-hydroxy-, compd. with 2-[2-[4-[(4-chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]ethanol (1:1);2-Naphthoic acid, 4,4'-methylenebis[3-hydroxy-, compd. with 2-[2-[4-(p-chloro-α-phenylbenzyl)-1-piperazinyl]ethoxy]ethanol (1:1) (8CI);2-Naphthoic acid, 4,4'-methylenebis[3-hydroxy-, hydroxyzine salt (6CI);Atarax P | | CAS: | 10246-75-0 | | MF: | C44H43ClN2O8 | | MW: | 763.27 | | EINECS: | 233-582-1 | | Product Categories: | VISTARIL | | Mol File: | 10246-75-0.mol |  |
| | Hydroxyzine pamoate Chemical Properties |
| Melting point | >155°C (dec.) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Yellow | | Major Application | pharmaceutical | | InChIKey | ASDOKGIIKXGMNB-UHFFFAOYSA-N | | SMILES | ClC1=CC=C(C=C1)C(N2CCN(CCOCCO)CC2)C3=CC=CC=C3.O=C(O)C4=C(O)C(CC5=C(C=CC=C6)C6=CC(C(O)=O)=C5O)=C7C=CC=CC7=C4 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | HS Code | 2933595960 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Hydroxyzine pamoate Usage And Synthesis |
| Uses | anxiolytic, antihistaminic | | Uses | Hydroxyzine Pamoate is an H1 receptor antagonist. Anxiolytic. Antihistaminic. | | in vivo | Hydroxyzine pamoate can be administered intravenously and orally[2].
Hydroxyzine pamoate metabolite deschlorocycline induces congenital malformations[4].
Example of configuring an oral suspension of Hydroxyzine pamoate 5 mg/mL: Hydroxyzine pamoate 850 mg, Xanthan gum 1 g, Propylene glycol 5 mL, Sorbic acid 200 mg, Sorbitol solution 20 mL, Flavor q.s., Syrup q.s. to 100 mL[5]. | Animal Model: | Mature female pregnant rats weighing 240 g[4] | | Dosage: | 100, 200 mg/kg | | Administration: | | | Result: | Showed 100 mg/kg produced 25.7% and 42.9% deformed pups per kilogram of body weight; 200 mg/kg produced 100% deformed pups per kilogram of body weight. |
| Animal Model: | Dog received IV hydroxyzine dihydrochloride[2][3] | | Dosage: | 2 mg/kg; daily; one day | | Administration: | Intravenous injection (i.v.); Oral gavage (p.o.) | | Result: | Showed that there was no significant difference at the 5% level in GWS (erythema×firmness×average diameter) between the two dosing methods. |
| | IC 50 | H1 Receptor |
| | Hydroxyzine pamoate Preparation Products And Raw materials |
|