| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Mercury(II) trifluoromethanesulfonate manufacturers
|
| | Mercury(II) trifluoromethanesulfonate Basic information |
| | Mercury(II) trifluoromethanesulfonate Chemical Properties |
| Melting point | >350 °C (lit.) | | solubility | It is soluble in H2O and CH3CN, fairly soluble in CH3NO2 and CH2Cl2, insoluble in hexane, ether, and toluene. | | form | Powder | | color | White | | Sensitive | Moisture Sensitive | | Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.05 mg/m3; Ceiling 0.1 mg/m3 | | Stability: | hygroscopic | | InChI | 1S/2CHF3O3S.Hg/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 | | InChIKey | BPVYMDMPLCOQPJ-UHFFFAOYSA-L | | SMILES | [Hg++].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F |
| Hazard Codes | T+,N,T,C | | Risk Statements | 26/27/28-33-50/53 | | Safety Statements | 13-28-36-45-60-61 | | RIDADR | UN 2025 6.1/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Toxic | | HazardClass | 6.1 | | PackingGroup | II | | HS Code | 28521000 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| | Mercury(II) trifluoromethanesulfonate Usage And Synthesis |
| Uses | Hg(OTf)2 exhibits remarkable catalytic activity for the hydroxylative cyclization of 1,6-enynes. Mercuric triflate is a very versatile reagent and has been used for several organic catalytic transformations including C-C bond forming cyclizations, alkyne hydrations, heterocycle synthesis and very recently in C-N bond forming reactions. Commonly used as the metal source for Lewis acid catalyzed asymmetric reactions. | | reaction suitability | core: mercury reagent type: catalyst |
| | Mercury(II) trifluoromethanesulfonate Preparation Products And Raw materials |
|