| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-Asparatic acid-15N Basic information |
| | L-Asparatic acid-15N Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Aqueous Acid (Slightly) | | form | Solid | | color | Off-White | | Optical Rotation | [α]25/D +25.0°, c = 2 in 5 M HCl | | Stability: | Hygroscopic | | InChI | 1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i5+1 | | InChIKey | CKLJMWTZIZZHCS-KPHKZEKTSA-N | | SMILES | [15NH2][C@@H](CC(O)=O)C(O)=O | | CAS Number Unlabeled | 56-84-8 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | CI9098500 | | HS Code | 28459000 | | Storage Class | 11 - Combustible Solids |
| | L-Asparatic acid-15N Usage And Synthesis |
| Chemical Properties | Solid | | Uses | L-Aspartic Acid-15N is labelled L-Aspartic Acid (A790024), a non-essential amino acid found in food sources. L-Aspartic Acid is one of the 20 proteinogenic amino acids; the building blocks of proteins. Its conjugate base L-aspartate is an excitatory neurotransmitter in the central nervous system. |
| | L-Asparatic acid-15N Preparation Products And Raw materials |
|