| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 2,2'-DIIODOBIPHENYL
-
-
2026-06-30
- CAS:2236-52-4
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | 2,2'-Diiodobiphenyl Basic information |
| Product Name: | 2,2'-Diiodobiphenyl | | Synonyms: | 1-iodo-2-(2-iodophenyl)benzene;2,2'-Diiodobiphenyl>1,1'-Biphenyl, 2,2'-diiodo-;2,2'-DIIODOBIPHENYL ISO 9001:2015 REACH;SKL011;2,2'-Diiodobiphenyl;2,2′-Diiodobiphenyl, CAS 2236-52-4;2,2'-Diiodobiphenyl | | CAS: | 2236-52-4 | | MF: | C12H8I2 | | MW: | 406 | | EINECS: | | | Product Categories: | Biphenyl derivatives | | Mol File: | 2236-52-4.mol |  |
| | 2,2'-Diiodobiphenyl Chemical Properties |
| Melting point | 210-211℃ | | Boiling point | 130-150 °C(Press: 0.7 Torr) | | density | 2.041±0.06 g/cm3(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C12H8I2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H | | InChIKey | OZVRXSGTNWILMN-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2I)=CC=CC=C1I |
| RIDADR | UN 3152 9/PG II | | HS Code | 2903.99.8001 | | HazardClass | 9 | | PackingGroup | II |
| | 2,2'-Diiodobiphenyl Usage And Synthesis |
| | 2,2'-Diiodobiphenyl Preparation Products And Raw materials |
|